2-Pyridinecarboxylicacid,5-cyano-(9CI)
5-cyanopyridine-2-carboxylic acid
CAS: 53234-55-2
Molecular Formula: C7H4N2O2
2-Pyridinecarboxylicacid,5-cyano-(9CI) - Names and Identifiers
| Name | 5-cyanopyridine-2-carboxylic acid |
| Synonyms | 5-cyanopicolinic acid 5-Cyanopicoliniic Acid 5-Cyano-2-pyridinecarboxylic aci 5-Cyano-2-pyridinecarboxylicacid 5-cyano-2-pyridincarboxylic acid 5-cyanopyridine-2-carboxylic acid 5-Cyano-2-pyridinecarboxylic acid 5-Cyanopyridine-2-carboxylic acid 5-cyano-2-pyridinecarboxylic acid 5-Cyano-pyridin-2-carboxylic acid 2-Pyridinecarboxylicacid,5-cyano-(9CI) |
| CAS | 53234-55-2 |
| EINECS | 684-461-9 |
| InChI | InChI=1/C7H4N2O2/c8-3-5-1-2-6(7(10)11)9-4-5/h1-2,4H,(H,10,11) |
2-Pyridinecarboxylicacid,5-cyano-(9CI) - Physico-chemical Properties
| Molecular Formula | C7H4N2O2 |
| Molar Mass | 148.12 |
| Density | 1.42±0.1 g/cm3(Predicted) |
| Melting Point | 212-214℃ |
| Boling Point | 370.7±27.0 °C(Predicted) |
| Flash Point | 178°C |
| Water Solubility | Sparingly soluble in water.(0.26 g/L) (25°C), |
| Vapor Presure | 3.77E-06mmHg at 25°C |
| pKa | 2.98±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.596 |
2-Pyridinecarboxylicacid,5-cyano-(9CI) - Risk and Safety
| Hazard Symbols | T - Toxic |
| Risk Codes | 25 - Toxic if swallowed |
| Safety Description | 45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Hazard Class | IRRITANT |
2-Pyridinecarboxylicacid,5-cyano-(9CI) - Introduction
The acid is an organic compound whose chemical formula is C7H4N2O2. The following is a description of its nature, use, preparation and safety information:
Nature:
1. Appearance: acid is a white to light yellow crystalline solid.
2. Solubility: It is soluble in water and common organic solvents, such as ethanol and acetone.
3. Melting point: Its melting point is about 206-207 degrees Celsius.
4. Chemical properties: acid is an acidic compound that can react with alkali in water to form the corresponding salt.
Use:
1. chemical reagent: acid is often used as raw material or intermediate in organic synthesis.
2. drug synthesis: it can be used to synthesize some drugs containing pyridine structure.
3. pesticide synthesis: acid can be used to synthesize some pesticides and herbicides.
Preparation Method:
There are many preparation methods for acid, and common methods include:
1. Pyridine potassium cyanide reacts to produce 5-cyano pyridine, and then reacts with CO2 to produce pyridine and acid. br>2. pyridine and chloroacetonitrile react to produce 2-chloroacetonitrylpyridine, which then reacts with sodium cyanide to obtain acid.
Safety Information:
1. acid is a low-toxic substance, but it is still necessary to pay attention to safe operation.
2. Avoid direct contact with skin and eyes during use. If in contact, rinse immediately with plenty of water.
3. when heating or handling high-concentration acid, use personal protective equipment such as protective gloves and goggles.
4. in storage should be away from the fire and oxidant, stored in a dry, ventilated place.
Nature:
1. Appearance: acid is a white to light yellow crystalline solid.
2. Solubility: It is soluble in water and common organic solvents, such as ethanol and acetone.
3. Melting point: Its melting point is about 206-207 degrees Celsius.
4. Chemical properties: acid is an acidic compound that can react with alkali in water to form the corresponding salt.
Use:
1. chemical reagent: acid is often used as raw material or intermediate in organic synthesis.
2. drug synthesis: it can be used to synthesize some drugs containing pyridine structure.
3. pesticide synthesis: acid can be used to synthesize some pesticides and herbicides.
Preparation Method:
There are many preparation methods for acid, and common methods include:
1. Pyridine potassium cyanide reacts to produce 5-cyano pyridine, and then reacts with CO2 to produce pyridine and acid. br>2. pyridine and chloroacetonitrile react to produce 2-chloroacetonitrylpyridine, which then reacts with sodium cyanide to obtain acid.
Safety Information:
1. acid is a low-toxic substance, but it is still necessary to pay attention to safe operation.
2. Avoid direct contact with skin and eyes during use. If in contact, rinse immediately with plenty of water.
3. when heating or handling high-concentration acid, use personal protective equipment such as protective gloves and goggles.
4. in storage should be away from the fire and oxidant, stored in a dry, ventilated place.
Last Update：2024-04-09 02:00:46
Supplier List
Product Name: 5-cyano-2-pyridinecarboxylic acid Visit Supplier Webpage Request for quotation
CAS: 53234-55-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 53234-55-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 5-Cyanopyridine-2-carboxylic acid Request for quotation
CAS: 53234-55-2
Tel: 86-10-10086 81625225
Email: yeqim@boyechemicals.com
Mobile: 86-15387090420
QQ: 1377812380
Wechat: 15387090420
CAS: 53234-55-2
Tel: 86-10-10086 81625225
Email: yeqim@boyechemicals.com
Mobile: 86-15387090420
QQ: 1377812380
Wechat: 15387090420
Product Name: 5-cyano-2-pyridinecarboxylic acid Visit Supplier Webpage Request for quotation
CAS: 53234-55-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 53234-55-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 5-Cyanopyridine-2-carboxylic acid Request for quotation
CAS: 53234-55-2
Tel: 86-10-10086 81625225
Email: yeqim@boyechemicals.com
Mobile: 86-15387090420
QQ: 1377812380
Wechat: 15387090420
CAS: 53234-55-2
Tel: 86-10-10086 81625225
Email: yeqim@boyechemicals.com
Mobile: 86-15387090420
QQ: 1377812380
Wechat: 15387090420
View History