2-amino-5-bromo-4-methyl-3-nitropyridinium

2-amino-5-bromo-4-methyl-3-nitropyridinium - Names and Identifiers

Name	2-AMINO-5-BROMO-4-METHYL-3-NITROPYRIDINE
Synonyms	2-Ami 2-AMINO-3-NITRO-5-BROMO-4-PICOLINE 2-AMINO-5-BROMO-3-NITRO-4-PICOLINE 2-Amino-5-bromo-3-nitro-GAMMA-picoline 5-bromo-4-methyl-3-nitropyridin-2-amine 5-bromo-4-methyl-3-nitro-2-Pyridinamine 2-Amino-5-bromo-4-methyl-3-nitropyridine 2-AMINO-3-NITRO-4-METHYL-5-BROMOPYRIDINE 2-AMINO-5-BROMO-4-METHYL-3-NITROPYRIDINE 2-PYRIDINAMINE, 5-BROMO-4-METHYL-3-NITRO- 2-amino-5-bromo-4-methyl-3-nitropyridinium
CAS	100367-40-6
EINECS	634-469-3
InChI	InChI=1/C6H6BrN3O2/c1-3-4(7)2-9-6(8)5(3)10(11)12/h2H,1H3,(H2,8,9)

2-amino-5-bromo-4-methyl-3-nitropyridinium - Physico-chemical Properties

Molecular Formula	C6H6BrN3O2
Molar Mass	232.03
Density	1.795±0.06 g/cm3(Predicted)
Melting Point	160-164
Boling Point	314.1±37.0 °C(Predicted)
Flash Point	143.8°C
Vapor Presure	0.000476mmHg at 25°C
pKa	0.78±0.50(Predicted)
Storage Condition	Keep in dark place,Inert atmosphere,2-8°C
Refractive Index	1.658
MDL	MFCD00092197

2-amino-5-bromo-4-methyl-3-nitropyridinium - Risk and Safety

Hazard Symbols	Xi - Irritant
Hazard Note	Irritant

2-amino-5-bromo-4-methyl-3-nitropyridinium - Introduction

2-Amino-5-bromo-3-nitro-4-methylpyridine is an organic compound with the chemical formula C8H7BrN3O2. It has the following properties:

1. Appearance: 2-amino -5-bromo -3-nitro -4-methyl pyridine is colorless or light yellow crystal or crystalline powder.

2. melting point: its melting point is about 160-165 ℃.

3. solubility: almost insoluble in water, soluble in organic solvents such as ethanol, chloroform, methanol, etc.

4. Chemical properties: It is an organic halogenated compound with strong nitro substituents and bromine atoms. It can be electrophilic or nucleophilic substitution reactions in some chemical reactions, as well as some alkylation, arylation and other reactions.

2-amino -5-bromo -3-nitro -4-methyl pyridine in some areas have the following applications:

1. pesticides and insecticides: can be used as intermediates for the preparation of pesticides and insecticides.

2. Drug research: In the field of medicine, it can be used in the synthesis and research of certain drugs, such as anti-tuberculosis drugs.

3. scientific research experiment: in the chemical laboratory, it can be used as a reagent and reaction intermediate in organic synthesis.

A common method for preparing 2-amino-5-bromo-3-nitro-4-methylpyridine is as follows:

1. nitration reaction: 2-amino -5-bromo -4-methyl pyridine and nitric acid reaction, through nitration in the molecule to introduce nitro substituents.

2. aromatic electrophilic substitution reaction: the use of electrophilic reagents such as bromine under appropriate conditions with 2-amino -5-methyl pyridine reaction to achieve the substitution of bromine atoms.

in terms of safety information, 2-amino -5-bromo -3-nitro -4-methyl pyridine should pay attention to the following matters during storage and use:

1. avoid contact with skin and eyes, such as accidental contact, please immediately rinse with plenty of water, and seek medical help.

2. Keep away from fire and high temperature, avoid contact with combustible materials.

3. Store in a sealed container in a dry, cool and well-ventilated place.

4. Wear protective gloves, goggles and protective clothing during operation to avoid inhalation, ingestion or skin contact.

Please read the relevant safety instructions carefully before use, and strictly follow the correct operation method.

Last Update：2024-04-09 20:11:46