2-amino-7-bromofluorene
2-amino-7-bromofluorene
CAS: 6638-60-4
Molecular Formula: C13H10BrN
2-amino-7-bromofluorene - Names and Identifiers
| Name | 2-amino-7-bromofluorene |
| Synonyms | 2-Amino-7-Bromofluor 7-bromo-fluoren-2-amin 7-AMINO-2-BROMOFLUORENE 2-amino-7-bromofluorene 2-Amino-7-bromofluorene 2-AMINO-7-BROMOFLUOROENE 7-BROMO-9H-FLUOREN-2-AMINE 2-Bromo-7-amino-9H-fluorene 2-Amino-7-bromo-9H-fluorene |
| CAS | 6638-60-4 |
| EINECS | 625-606-8 |
| InChI | InChI=1/C13H10BrN/c14-10-1-3-12-8(6-10)5-9-7-11(15)2-4-13(9)12/h1-4,6-7H,5,15H2 |
| InChIKey | RJWYTISHBMNMOZ-UHFFFAOYSA-N |
2-amino-7-bromofluorene - Physico-chemical Properties
| Molecular Formula | C13H10BrN |
| Molar Mass | 260.13 |
| Density | 1.559±0.06 g/cm3(Predicted) |
| Melting Point | 148-149 °C (lit.) |
| Boling Point | 431.9±38.0 °C(Predicted) |
| Flash Point | 215°C |
| Water Solubility | Sparingly soluble in water. (0.724 mg/L) |
| Vapor Presure | 1.16E-07mmHg at 25°C |
| pKa | 3.90±0.20(Predicted) |
| Storage Condition | Room Temprature |
| Refractive Index | 1.717 |
2-amino-7-bromofluorene - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| RTECS | LL5150050 |
2-amino-7-bromofluorene - Introduction
2-amino-7-bromofluorene is an organic compound with the chemical formula C13H10BrN. Its properties include:
1. Appearance: 2-amino-7-bromofluorene is a light yellow to yellow crystal or powder substance.
2. solubility: soluble in organic solvents such as ethanol, acetone, dichloromethane, insoluble in water.
3. Melting point: The melting point of 2-amino-7-bromofluorene is about 140-145 degrees Celsius.
2-amino-7-bromofluorene is mainly used as an intermediate in organic synthesis and can be used to synthesize substances with fluorescent properties. It can exert the reactivity of amino and bromine in organic synthesis reactions, and participate in a variety of substitution reactions or coupling reactions.
The method of preparing 2-amino-7-bromofluorene can be carried out by the following steps:
1. First, benzene reacts with lithium bromide to generate bromobenzene.
2. Next, bromobenzene is reacted with pyridine to produce 3-bromopyridine.
3. then, 3-bromopyridine and 2-amino fluorene undergo nucleophilic substitution reaction under the catalysis of amino reagent to generate 2-amino-7-bromofluorene.
When using 2-amino-7-bromofluorene, you need to pay attention to the following safety information:
1. 2-amino-7-bromofluorene may be irritating to the skin, eyes and respiratory tract. Avoid contact with skin and eyes and avoid inhaling its dust.
2. During operation, it is recommended to wear chemical protective gloves, protective glasses and protective masks to ensure safety.
3. avoid 2-amino-7-bromofluorene and oxidant, strong acid or strong base and other substances contact, to prevent dangerous reaction.
4. When operating, please do it in a well-ventilated place and avoid inhaling its volatiles.
When using and handling 2-amino-7-bromofluorene, please strictly follow the safe operation procedures of chemicals, and please use it after understanding its nature and usage.
1. Appearance: 2-amino-7-bromofluorene is a light yellow to yellow crystal or powder substance.
2. solubility: soluble in organic solvents such as ethanol, acetone, dichloromethane, insoluble in water.
3. Melting point: The melting point of 2-amino-7-bromofluorene is about 140-145 degrees Celsius.
2-amino-7-bromofluorene is mainly used as an intermediate in organic synthesis and can be used to synthesize substances with fluorescent properties. It can exert the reactivity of amino and bromine in organic synthesis reactions, and participate in a variety of substitution reactions or coupling reactions.
The method of preparing 2-amino-7-bromofluorene can be carried out by the following steps:
1. First, benzene reacts with lithium bromide to generate bromobenzene.
2. Next, bromobenzene is reacted with pyridine to produce 3-bromopyridine.
3. then, 3-bromopyridine and 2-amino fluorene undergo nucleophilic substitution reaction under the catalysis of amino reagent to generate 2-amino-7-bromofluorene.
When using 2-amino-7-bromofluorene, you need to pay attention to the following safety information:
1. 2-amino-7-bromofluorene may be irritating to the skin, eyes and respiratory tract. Avoid contact with skin and eyes and avoid inhaling its dust.
2. During operation, it is recommended to wear chemical protective gloves, protective glasses and protective masks to ensure safety.
3. avoid 2-amino-7-bromofluorene and oxidant, strong acid or strong base and other substances contact, to prevent dangerous reaction.
4. When operating, please do it in a well-ventilated place and avoid inhaling its volatiles.
When using and handling 2-amino-7-bromofluorene, please strictly follow the safe operation procedures of chemicals, and please use it after understanding its nature and usage.
Last Update：2024-04-10 22:29:15
Supplier List
Product Name: 2-Amino-7-Bromofluorene Visit Supplier Webpage Request for quotation
CAS: 6638-60-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 6638-60-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 2-Amino-7-Bromofluorene Visit Supplier Webpage Request for quotation
CAS: 6638-60-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 6638-60-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History