2-hydroxypyridine-3-carbaldehyde
2-Hydroxynicotinaldehyde
CAS: 36404-89-4
Molecular Formula: C6H5NO2
2-hydroxypyridine-3-carbaldehyde - Names and Identifiers
| Name | 2-Hydroxynicotinaldehyde |
| Synonyms | 2-Hydroxynicotinaldehyde 2-hydroxypyridine-3-carbaldehyde 2-keto-1H-pyridine-3-carbaldehyde 2-Hydroxypyridine-3-carboxaldehyde 2-OXO-1,2-DIHYDRO-3-PYRIDINECARBALDEHYDE 2-Oxo-1,2-dihydropyridine-3-carbaldehyde 1,2-dihydro-2-oxo-3-Pyridinecarboxaldehyde |
| CAS | 36404-89-4 |
| InChI | InChI=1/C6H5NO2/c8-4-5-2-1-3-7-6(5)9/h1-4H,(H,7,9) |
2-hydroxypyridine-3-carbaldehyde - Physico-chemical Properties
| Molecular Formula | C6H5NO2 |
| Molar Mass | 123.11 |
| Density | 1.365±0.06 g/cm3(Predicted) |
| Melting Point | 220-222° |
| Boling Point | 50 °C(Press: 80 Torr) |
| Flash Point | 137.634°C |
| Vapor Presure | 0.001mmHg at 25°C |
| Appearance | powder or crystals |
| pKa | 10.18±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.629 |
2-hydroxypyridine-3-carbaldehyde - Risk and Safety
| Hazard Symbols | Xn - Harmful |
| Risk Codes | R22 - Harmful if swallowed R36 - Irritating to the eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S24/25 - Avoid contact with skin and eyes. |
| HS Code | 29333990 |
| Hazard Class | IRRITANT |
2-hydroxypyridine-3-carbaldehyde - Introduction
2-Hydroxynicotinaldehyde is an organic compound with the chemical formula C6H5NO2. The following is a description of its nature, use, preparation and safety information:
1. nature:
2-Hydroxynicotinaldehyde is a white to pale yellow crystalline solid. It is soluble in water and organic solvents such as ethanol and dimethylformamide at normal temperature. It has an aromatic and bitter taste, while presenting the characteristic odor of nicotinic aldehyde. It will gradually darken when exposed to air.
2. use:
2-Hydroxynicotinaldehyde has certain application value in organic synthesis. It can be used as an intermediate in the preparation of pharmaceuticals and other organic compounds. For example, it can be used in the synthesis of drugs containing pyridine structures, such as antitumor drugs, antidepressant drugs, etc. In addition, it can be used as a catalyst, a coordination ligand, an antiseptic, and the like.
3. Preparation method:
2-Hydroxynicotinaldehyde is generally prepared by oxidation of nicotinic acid (3-hydroxypyridine-4-carboxylic acid). Commonly used methods include the oxidation of niacin by oxidizing agents such as silver oxide and hydrogen peroxide.
4. Safety Information:
2-Hydroxynicotinaldehyde is generally considered to be relatively safe under normal conditions of use. However, as a chemical, proper laboratory handling and protective measures are necessary. It is irritating to the eyes, skin and respiratory tract, so it is necessary to wear appropriate protective gloves, protective glasses and protective mask during operation. In addition, 2-Hydroxynicotinaldehyde should be stored in a dry, cool, well-ventilated place, away from ignition and oxidizing agents.
1. nature:
2-Hydroxynicotinaldehyde is a white to pale yellow crystalline solid. It is soluble in water and organic solvents such as ethanol and dimethylformamide at normal temperature. It has an aromatic and bitter taste, while presenting the characteristic odor of nicotinic aldehyde. It will gradually darken when exposed to air.
2. use:
2-Hydroxynicotinaldehyde has certain application value in organic synthesis. It can be used as an intermediate in the preparation of pharmaceuticals and other organic compounds. For example, it can be used in the synthesis of drugs containing pyridine structures, such as antitumor drugs, antidepressant drugs, etc. In addition, it can be used as a catalyst, a coordination ligand, an antiseptic, and the like.
3. Preparation method:
2-Hydroxynicotinaldehyde is generally prepared by oxidation of nicotinic acid (3-hydroxypyridine-4-carboxylic acid). Commonly used methods include the oxidation of niacin by oxidizing agents such as silver oxide and hydrogen peroxide.
4. Safety Information:
2-Hydroxynicotinaldehyde is generally considered to be relatively safe under normal conditions of use. However, as a chemical, proper laboratory handling and protective measures are necessary. It is irritating to the eyes, skin and respiratory tract, so it is necessary to wear appropriate protective gloves, protective glasses and protective mask during operation. In addition, 2-Hydroxynicotinaldehyde should be stored in a dry, cool, well-ventilated place, away from ignition and oxidizing agents.
Last Update：2024-04-09 20:52:54
