21577-57-1

21577-57-1 - Names and Identifiers

Name	2-Amino-4,6-dimethoxybenzoic acid
Synonyms	2-Amino-4,6-dimethoxybenzoic acid 2-AMINO-4,6-DIMETHOXY-BENZOIC ACID 4,6-dimethoxy-2-amino benzoic acid 2-Amino-4,6-dimethoxybenzoic acid benzoic acid, 2-amino-4,6-dimethoxy- Benzoic acid, 2-amino-4,6-dimethoxy-
CAS	21577-57-1
InChI	InChI=1/C9H11NO4/c1-13-5-3-6(10)8(9(11)12)7(4-5)14-2/h3-4H,10H2,1-2H3,(H,11,12)

21577-57-1 - Physico-chemical Properties

Molecular Formula	C9H11NO4
Molar Mass	197.19
Density	1.295±0.06 g/cm3(Predicted)
Melting Point	120-125 °C
Boling Point	374.8±42.0 °C(Predicted)
Flash Point	180.478°C
Vapor Presure	0mmHg at 25°C
pKa	5.10±0.10(Predicted)
Storage Condition	Sealed in dry,Room Temperature
Refractive Index	1.582
Use	This product is for scientific research only and shall not be used for other purposes.

21577-57-1 - Risk and Safety

Risk Codes	36 - Irritating to the eyes
Safety Description	26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.

21577-57-1 - Introduction

2-Amino-4,6-dimethoxybenzoic acid is an organic compound with the chemical formula C9H11NO4.

its nature:

1. Appearance: 2-Amino-4,6-dimethoxybenzoic acid is colorless to light yellow crystal or powder.
2. Solubility: Soluble in most organic solvents, such as ethanol, chloroform and dimethyl sulfoxide.
3. Melting Point: about 190-193 degrees Celsius.

Its purpose:

1. Chemical reagent: 2-Amino-4,6-dimethoxybenzoic acid can be used as an important reagent in organic synthesis, such as for the preparation of other compounds or as an intermediate.
2. Drug research: Due to its special structure and properties, 2-Amino-4,6-dimethoxybenzoic acid is also commonly used in the field of drug research, such as the development of new drug compounds.

Method:

2-Amino-4,6-dimethoxybenzoic acid can generally be prepared by the reaction of phenylacetyl chloride and 2-Amino-4, 6-dimethoxyphenol.

Safety Information:

1. 2-Amino-4,6-dimethoxybenzoic acid should be stored in a dry, well-ventilated place, away from direct sunlight.
2. In case of contact with skin or eyes, rinse immediately with plenty of water and seek medical assistance.
3. Use should wear protective gloves and glasses, avoid inhalation or contact with the skin.
4. If you need to dispose of waste, you should follow the relevant local laws and regulations for disposal.

Last Update：2024-04-09 02:00:44