21717-29-3
6-ethylpyridin-2-amine
CAS: 21717-29-3
Molecular Formula: C7H10N2
21717-29-3 - Names and Identifiers
| Name | 6-ethylpyridin-2-amine |
| Synonyms | 6-ETHYLPYRIDIN-2-AMINE 6-ethylpyridin-2-amine 6-ETHYL-2-PYRIDINAMINE 2-AMINO-6-ETHYLPYRIDINE 2-amino-6-ethylpyridine 2-Pyridinamine, 6-ethyl- 6-ethyl-2-pyridin-1-iumamine |
| CAS | 21717-29-3 |
| EINECS | 244-540-7 |
| InChI | InChI=1/C7H10N2/c1-2-6-4-3-5-7(8)9-6/h3-5H,2H2,1H3,(H2,8,9) |
21717-29-3 - Physico-chemical Properties
| Molecular Formula | C7H10N2 |
| Molar Mass | 122.17 |
| Density | 1.037±0.06 g/cm3(Predicted) |
| Boling Point | 217-219 °C |
| Flash Point | 108.5°C |
| Water Solubility | Slightly soluble in water. |
| Vapor Presure | 0.124mmHg at 25°C |
| pKa | 6.98±0.24(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Refractive Index | 1.5680 |
| MDL | MFCD00218265 |
21717-29-3 - Risk and Safety
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | UN2810 |
| Hazard Note | Irritant |
| Hazard Class | 6.1 |
| Packing Group | III |
21717-29-3 - Introduction
6-ethylpyridin-2-amine(6-ethylpyridin-2-amine) is an organic compound with the chemical formula C8H12N2. It is a compound containing a pyridine ring in which the ethyl group is attached at position 2 and the amino group is attached at position 6.
6-ethylpyridin-2-amine has the following properties:
1. Appearance: colorless or light yellow liquid.
2. Solubility: Soluble in water and organic solvents such as ethanol and ethers.
3. Melting point and boiling point: melting point is about 60-65 ℃, boiling point is about 188 ℃.
6-ethylpyridin-2-amine has a wide range of applications:
1. As an organic synthesis intermediate, can be used to synthesize other drugs, dyes and pesticides and other organic compounds.
2. In chemical research, it can be used as a ligand for complex formation reaction.
3. Used as a catalyst precursor, participate in a variety of chemical reactions such as oxidation, selective hydrogenation and other processes.
6-ethylpyridin-2-amine can be prepared by the following method:
1. By pyridine and nitrogen heterocyclic ethyl reaction.
2. 2-Amino-6-methylpyridine is obtained by the reduction reaction of p-nitrobenzaldehyde and nitrolinear ketone, and then the methyl group is converted into an ethyl group by alkylation reaction.
For safety information, please note the following:
1. 6-ethylpyridin-2-amine is an organic compound, please avoid direct contact with skin and eyes.
2. Please wear appropriate protective gloves and eye protection during operation.
3. Keep well ventilated during use and storage, and keep away from fire and high temperature.
4. Avoid reacting with oxidants and strong acids, which may produce dangerous substances or violent reactions.
5. In case of inhalation or accidental ingestion, please seek medical help immediately and provide appropriate emergency treatment.
6-ethylpyridin-2-amine has the following properties:
1. Appearance: colorless or light yellow liquid.
2. Solubility: Soluble in water and organic solvents such as ethanol and ethers.
3. Melting point and boiling point: melting point is about 60-65 ℃, boiling point is about 188 ℃.
6-ethylpyridin-2-amine has a wide range of applications:
1. As an organic synthesis intermediate, can be used to synthesize other drugs, dyes and pesticides and other organic compounds.
2. In chemical research, it can be used as a ligand for complex formation reaction.
3. Used as a catalyst precursor, participate in a variety of chemical reactions such as oxidation, selective hydrogenation and other processes.
6-ethylpyridin-2-amine can be prepared by the following method:
1. By pyridine and nitrogen heterocyclic ethyl reaction.
2. 2-Amino-6-methylpyridine is obtained by the reduction reaction of p-nitrobenzaldehyde and nitrolinear ketone, and then the methyl group is converted into an ethyl group by alkylation reaction.
For safety information, please note the following:
1. 6-ethylpyridin-2-amine is an organic compound, please avoid direct contact with skin and eyes.
2. Please wear appropriate protective gloves and eye protection during operation.
3. Keep well ventilated during use and storage, and keep away from fire and high temperature.
4. Avoid reacting with oxidants and strong acids, which may produce dangerous substances or violent reactions.
5. In case of inhalation or accidental ingestion, please seek medical help immediately and provide appropriate emergency treatment.
Last Update：2024-04-09 15:17:55
Supplier List
Product Name: 2-Amino-6-Ethylpyridine Visit Supplier Webpage Request for quotation
CAS: 21717-29-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 21717-29-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 2-Amino-6-Ethylpyridine Visit Supplier Webpage Request for quotation
CAS: 21717-29-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 21717-29-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History