222-241-2
Nitrobenzanilide
CAS: 3393-96-2
Molecular Formula: C13H10N2O3
222-241-2 - Names and Identifiers
| Name | Nitrobenzanilide |
| Synonyms | 222-241-2 Nitrobenzanilide 4'-NITROBENZANILIDE Benzanilide, 4'-nitro- N-(4-NITROPHENYL)BENZAMIDE N-(4-Nitrophenyl)benzamide Aniline, N-benzoyl-p-nitro- Benzamide,N-(4-nitrophenyl)- Benzamide, N-(4-nitrophenyl)- Benzamide, N-(p-nitrophenyl)- |
| CAS | 3393-96-2 |
| EINECS | 222-241-2 |
| InChI | InChI=1/C13H10N2O3/c16-13(10-4-2-1-3-5-10)14-11-6-8-12(9-7-11)15(17)18/h1-9H,(H,14,16) |
222-241-2 - Physico-chemical Properties
| Molecular Formula | C13H10N2O3 |
| Molar Mass | 242.23 |
| Density | 1.344g/cm3 |
| Melting Point | 202-204°C |
| Boling Point | 327°C at 760 mmHg |
| Flash Point | 151.5°C |
| Vapor Presure | 0.000209mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Orange to Green |
| Refractive Index | 1.671 |
222-241-2 - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Hazard Class | IRRITANT |
