273-34-7
1H-1,2,3-triazolo(4,5-B)pyridine
CAS: 273-34-7
Molecular Formula: C5H4N4
273-34-7 - Names and Identifiers
| Name | 1H-1,2,3-triazolo(4,5-B)pyridine |
| Synonyms | 4-AZABENZOTRIAZOLE 2,7-Diazabenzimidazole 2,7-Diaza-1H-benzimidazole 1H-v-Triazolo[4,5-b]pyridine 1H-1,2,3-Triazolo[4,5-b]pyridine 1H-1,2,3-triazolo(4,5-B)pyridine 1H-1,2,3-TRIAZOLO[4,5-B]PYRIDINE 1H-1,2,3-TRIAZOLO[4,5-B]PYRIDIN-3-OL |
| CAS | 273-34-7 |
| InChI | InChI=1/C5H4N4/c1-2-4-5(6-3-1)8-9-7-4/h1-4H |
273-34-7 - Physico-chemical Properties
| Molecular Formula | C5H4N4 |
| Molar Mass | 120.11 |
| Density | 1.61 |
| Melting Point | 208°C (dec.)(lit.) |
| Boling Point | 230℃ |
| Flash Point | 93℃ |
| Vapor Presure | 0.376mmHg at 25°C |
| Appearance | powder |
| Color | light brown |
| pKa | 3.15±0.20(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.828 |
| MDL | MFCD00134183 |
273-34-7 - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| TSCA | No |
273-34-7 - Introduction
1H-1,2,3-triazolo (4,5-b) pyridine is an organic compound with the chemical formula C6H5N3. It has the following properties:
1. Appearance: White to light yellow solid.
2. Melting Point: about 130-135 ° C.
3. Solubility: soluble in ethanol, dimethylformamide and a small amount of water, insoluble in most organic solvents.
Some of the main uses of 1H-1,2,3-triazolo (4,5-b) pyridine include:
1. Chemical reagent: As a reagent in organic synthesis, it is used to synthesize other complex organic compounds.
2. Drug research: It is often used as an intermediate for drug design and development, and is used to synthesize biologically active compounds.
3. Coordination ligand: can be used to prepare metal complexes, used in catalytic reactions or other chemical processes.
Regarding the preparation method of 1H-1,2,3-triazolo (4,5-b) pyridine, the common method is synthesis through chemical reaction. There are many specific synthetic methods, such as the use of pyridine and lead nitrate reaction, and then reduction to obtain the target product.
As for safety information, 1H-1,2,3-triazolo (4,5-b) pyridine can be handled safely under general conditions, but the following matters still need to be paid attention:
1. Avoid contact with skin and eyes: Wear appropriate personal protective equipment, such as gloves and goggles.
2. Avoid inhalation: Good ventilation should be provided during operation to prevent inhalation of aerosol particles.
3. Storage: It should be stored in a closed container, away from heat sources and oxidants, and avoid prolonged exposure to air.
In General, 1H-1,2,3-triazolo (4,5-b) pyridine is a commonly used organic compound with multiple uses, but you still need to pay attention to safe operation measures when using it.
1. Appearance: White to light yellow solid.
2. Melting Point: about 130-135 ° C.
3. Solubility: soluble in ethanol, dimethylformamide and a small amount of water, insoluble in most organic solvents.
Some of the main uses of 1H-1,2,3-triazolo (4,5-b) pyridine include:
1. Chemical reagent: As a reagent in organic synthesis, it is used to synthesize other complex organic compounds.
2. Drug research: It is often used as an intermediate for drug design and development, and is used to synthesize biologically active compounds.
3. Coordination ligand: can be used to prepare metal complexes, used in catalytic reactions or other chemical processes.
Regarding the preparation method of 1H-1,2,3-triazolo (4,5-b) pyridine, the common method is synthesis through chemical reaction. There are many specific synthetic methods, such as the use of pyridine and lead nitrate reaction, and then reduction to obtain the target product.
As for safety information, 1H-1,2,3-triazolo (4,5-b) pyridine can be handled safely under general conditions, but the following matters still need to be paid attention:
1. Avoid contact with skin and eyes: Wear appropriate personal protective equipment, such as gloves and goggles.
2. Avoid inhalation: Good ventilation should be provided during operation to prevent inhalation of aerosol particles.
3. Storage: It should be stored in a closed container, away from heat sources and oxidants, and avoid prolonged exposure to air.
In General, 1H-1,2,3-triazolo (4,5-b) pyridine is a commonly used organic compound with multiple uses, but you still need to pay attention to safe operation measures when using it.
Last Update：2024-04-09 22:09:11
Supplier List
Product Name: 4-Azabenzotriazole Visit Supplier Webpage Request for quotation
CAS: 273-34-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 273-34-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 4-Azabenzotriazole Visit Supplier Webpage Request for quotation
CAS: 273-34-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 273-34-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History