283166-41-6
N'-hydroxy-2,2-dimethyl-2H-chromene-6-carboximidamide
CAS: 283166-41-6
Molecular Formula: C12H14N2O2
283166-41-6 - Names and Identifiers
| Name | N'-hydroxy-2,2-dimethyl-2H-chromene-6-carboximidamide |
| Synonyms | N'-hydroxy-2,2-dimethylchromene-6-carboximidamide N'-hydroxy-2,2-dimethyl-2H-chromene-6-carboximidamide N'-Hydroxy-2,2-dimethyl-2H-chromene-6-carboximidamide N'-HYDROXY-2,2-DIMETHYL-2H-CHROMENE-6-CARBOXIMIDAMIDE (E)-N'-hydroxy-2,2-diMethyl-2H-chroMene-6-carboxiMidaMide (E)-N'-hydroxy-2,2-dimethyl-2H-chromene-6-carboximidamide 2H-1-Benzopyran-6-carboxiMidaMide, N-hydroxy-2,2-diMethyl- 2H-1-benzopyran-6-carboximidamide, N'-hydroxy-2,2-dimethyl- |
| CAS | 283166-41-6 |
| EINECS | 604-604-1 |
| InChI | InChI=1/C12H14N2O2/c1-12(2)6-5-8-7-9(11(13)14-15)3-4-10(8)16-12/h3-7,15H,1-2H3,(H2,13,14) |
283166-41-6 - Physico-chemical Properties
| Molecular Formula | C12H14N2O2 |
| Molar Mass | 218.25 |
| Density | 1.22±0.1 g/cm3(Predicted) |
| Boling Point | 356.3±52.0 °C(Predicted) |
| Flash Point | 198°C |
| Vapor Presure | 3.04E-07mmHg at 25°C |
| pKa | 6.86±0.69(Predicted) |
| Refractive Index | 1.591 |
283166-41-6 - Introduction
N'-hydroxy-2, is an organic compound with the chemical formula C11H13N3O2. It has the following properties:
1. Appearance: N'-hydroxy-2, white solid.
2. Solubility: The compound is soluble in ethanol, dimethyl sulfoxide and acidic solvents, and insoluble in water.
3. Melting Point: N'-hydroxy-2, the melting point is 128-130 ° C.
4. Stability: It is stable at room temperature.
N'-hydroxy-2, the purpose:
1. As an organic synthesis intermediate, it can be used to synthesize other organic compounds.
2. In chemical research, the compound can be used to prepare biologically active compounds, such as drugs and pesticides.
3. Can also be used in dyes, coatings and plastics and other fields.
Preparation method: N'-hydroxy-2, preparation method is generally synthesized by chemical reaction. Specific preparation methods may vary according to specific experimental conditions and reaction requirements, and reference may be made to relevant organic synthesis literature or patents.
Safety information: There is currently less data on the toxicity, harmfulness and safety information of N'-hydroxy-2, so it is necessary to follow relevant laboratory safety practices when using or handling them, wear laboratory personal protective equipment to ensure the safe use of the compound. If toxicity data are available, it is recommended to refer to the relevant toxicology manual or obtain relevant information from a reliable chemical supplier.
1. Appearance: N'-hydroxy-2, white solid.
2. Solubility: The compound is soluble in ethanol, dimethyl sulfoxide and acidic solvents, and insoluble in water.
3. Melting Point: N'-hydroxy-2, the melting point is 128-130 ° C.
4. Stability: It is stable at room temperature.
N'-hydroxy-2, the purpose:
1. As an organic synthesis intermediate, it can be used to synthesize other organic compounds.
2. In chemical research, the compound can be used to prepare biologically active compounds, such as drugs and pesticides.
3. Can also be used in dyes, coatings and plastics and other fields.
Preparation method: N'-hydroxy-2, preparation method is generally synthesized by chemical reaction. Specific preparation methods may vary according to specific experimental conditions and reaction requirements, and reference may be made to relevant organic synthesis literature or patents.
Safety information: There is currently less data on the toxicity, harmfulness and safety information of N'-hydroxy-2, so it is necessary to follow relevant laboratory safety practices when using or handling them, wear laboratory personal protective equipment to ensure the safe use of the compound. If toxicity data are available, it is recommended to refer to the relevant toxicology manual or obtain relevant information from a reliable chemical supplier.
Last Update：2024-04-09 20:49:11
