3,3-difluoropiperidine
3,3-difluoropiperidine
CAS: 363179-66-2
Molecular Formula: C5H9F2N
3,3-difluoropiperidine - Names and Identifiers
| Name | 3,3-difluoropiperidine |
| Synonyms | 3,3-DIFLUOROPIPERIDINE 3,3-difluoropiperidine 3,3-Difluoropiperidine 3,3-difluoro-Piperidine piperidine, 3,3-difluoro- Piperidine, 3,3-difluoro- 3,3-difluoro-Piperidine HCl 3,3-difluoropyridine hydrochloride |
| CAS | 363179-66-2 |
| InChI | InChI=1/C5H9F2N/c6-5(7)2-1-3-8-4-5/h8H,1-4H2 |
3,3-difluoropiperidine - Physico-chemical Properties
| Molecular Formula | C5H9F2N |
| Molar Mass | 121.13 |
| Density | 1.08±0.1 g/cm3(Predicted) |
| Boling Point | 114.3±40.0 °C(Predicted) |
| Flash Point | 22.9°C |
| Vapor Presure | 20mmHg at 25°C |
| pKa | 6.51±0.10(Predicted) |
| Refractive Index | 1.401 |
3,3-difluoropiperidine - Introduction
3,3-difluoropiperidine is an organic compound with the chemical formula C5H8F2N. The following is a detailed description of the nature, use, preparation and safety information of 3,3-difluoropiperidine:
Nature:
1. Appearance: 3,3-difluoropiperidine is a colorless liquid.
2. melting point: about -80 ℃.
3. Boiling point: about 81-82 ℃.
4. density: about 1.094 g/cm.
5. Solubility: 3,3-difluoropiperidine is soluble in many organic solvents, such as ethanol, ether and dichloromethane.
Use:
1. Chemical synthesis intermediates: 3,3-difluoropiperidine can be used as intermediates for the synthesis of other organic compounds, and is widely used in the fields of drug synthesis and pesticide synthesis.
2. Insecticide: 3,3-difluoropiperidine has insecticidal activity and can be used to prepare insecticides.
Preparation Method:
There are many preparation methods for 3,3-difluoropiperidine. The following is one of the common methods:
First, 1,3-difluoropropane and piperidine are reacted through a nucleophilic substitution reaction to obtain a 3,3-difluoropiperidine product.
Safety Information:
1. 3,3-difluoropiperidine is an organic compound with certain toxicity. Good laboratory practices should be adopted during use and good ventilation conditions should be ensured.
2. avoid skin contact and inhalation of 3,3-difluoropiperidine vapor. In case of accidental contact, wash immediately with plenty of water and seek medical help.
3. Store 3,3-difluoropiperidine in a sealed, dry and cool place, away from fire and oxidizing agents.
Nature:
1. Appearance: 3,3-difluoropiperidine is a colorless liquid.
2. melting point: about -80 ℃.
3. Boiling point: about 81-82 ℃.
4. density: about 1.094 g/cm.
5. Solubility: 3,3-difluoropiperidine is soluble in many organic solvents, such as ethanol, ether and dichloromethane.
Use:
1. Chemical synthesis intermediates: 3,3-difluoropiperidine can be used as intermediates for the synthesis of other organic compounds, and is widely used in the fields of drug synthesis and pesticide synthesis.
2. Insecticide: 3,3-difluoropiperidine has insecticidal activity and can be used to prepare insecticides.
Preparation Method:
There are many preparation methods for 3,3-difluoropiperidine. The following is one of the common methods:
First, 1,3-difluoropropane and piperidine are reacted through a nucleophilic substitution reaction to obtain a 3,3-difluoropiperidine product.
Safety Information:
1. 3,3-difluoropiperidine is an organic compound with certain toxicity. Good laboratory practices should be adopted during use and good ventilation conditions should be ensured.
2. avoid skin contact and inhalation of 3,3-difluoropiperidine vapor. In case of accidental contact, wash immediately with plenty of water and seek medical help.
3. Store 3,3-difluoropiperidine in a sealed, dry and cool place, away from fire and oxidizing agents.
Last Update：2024-04-09 21:01:54
