3,4-Difluoro-N-Methyl-benzylaMine - Names and Identifiers
Name | 3,4-Difluoro-N-methylbenzenemethanamine
|
Synonyms | 3,4-Difluoro-N-methyl-benzylamine 3,4-Difluoro-N-Methyl-benzylaMine 3,4-Difluoro-N-methylbenzenemethanamine (3,4-Difluorophenyl)methyl](methyl)amine Benzenemethanamine, 3,4-difluoro-N-methyl 1-(3,4-difluorophenyl)-N-methylmethanamine 1-(3,4-Difluorophenyl)-N-methylmethanamine Benzenemethanamine, 3,4-difluoro-N-methyl- (9CI)
|
CAS | 748124-46-1
|
InChI | InChI=1/C8H9F2N/c1-11-5-6-2-3-7(9)8(10)4-6/h2-4,11H,5H2,1H3 |
3,4-Difluoro-N-Methyl-benzylaMine - Physico-chemical Properties
Molecular Formula | C8H9F2N
|
Molar Mass | 157.16 |
Density | 1.127g/cm3 |
Boling Point | 176.12°C at 760 mmHg |
Flash Point | 60.315°C |
Vapor Presure | 1.11mmHg at 25°C |
Refractive Index | 1.477 |
3,4-Difluoro-N-Methyl-benzylaMine - Introduction
3, is an organic compound whose chemical formula is C8H9F2N. The following is a description of its nature, use, preparation and safety information:
Nature:
1. Appearance: 3. It is a colorless to light yellow liquid.
2. Solubility: Soluble in many organic solvents, such as ethanol, ether and ketone.
3. Stability: It is relatively stable under normal temperature and pressure, but may be affected by light and heat.
Use:
3, is often used as an intermediate in organic synthesis. It can play a role in the field of drug synthesis, dye synthesis and pesticide synthesis.
Preparation Method:
3, the preparation of phosphonium can be obtained by reacting benzylamine with hydrogen fluoride. The specific steps are as follows:
1. Benzylamine and hydrogen fluoride are placed in a reaction vessel.
2. Stir the reactant mixture at an appropriate temperature.
3. The reactant mixture is filtered and washed to obtain 3, Ni.
Safety Information:
1.3, is an organic compound and should be stored in a dry place away from light.
2. During operation, attention should be paid to prevent it from contacting skin and eyes. In case of accidental contact, rinse immediately with water.
3. Due to its chemical properties, it should be kept away from fire and high temperature environment.
4. When handling or disposing of, please follow the appropriate safety procedures and follow local regulations.
Last Update:2024-04-09 21:04:16