3,5-Dimethyl-4-isoxazolemethanol - Names and Identifiers
Name | (3,5-DIMETHYL-4-ISOXAZOLYL)METHANOL
|
Synonyms | AKOS PAO-1564 RARECHEM AL BD 0516 3,5-Dimethyl-4-isoxazolemethanol 3,5-Dimethylisoxazole-4-methanol (3,5-DIMETHYL-4-ISOXAZOLYL)METHANOL (3,5-Dimethylisoxazol-4-yl)methanol 3,5-Dimethyl-4-hydroxymethylisoxazole (3,5-Dimethyl-1,2-oxazol-4-yl)methanol (3,5-dimethyl-1,2-oxazol-4-yl)methanol
|
CAS | 19788-36-4
|
InChI | InChI=1/C6H9NO2/c1-4-6(3-8)5(2)9-7-4/h8H,3H2,1-2H3 |
3,5-Dimethyl-4-isoxazolemethanol - Physico-chemical Properties
Molecular Formula | C6H9NO2
|
Molar Mass | 127.14 |
Density | 1.137±0.06 g/cm3(Predicted) |
Melting Point | 76 °C |
Boling Point | 96-97 |
Flash Point | 112.1°C |
Vapor Presure | 0.00577mmHg at 25°C |
pKa | 13.65±0.10(Predicted) |
Storage Condition | Sealed in dry,Store in freezer, under -20°C |
Sensitive | Light Sensitive |
Refractive Index | 1.497 |
Physical and Chemical Properties | Sensitivity: Light Sensitive |
3,5-Dimethyl-4-isoxazolemethanol - Risk and Safety
Hazard Symbols | Xi - Irritant
|
Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin.
|
Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection.
S24/25 - Avoid contact with skin and eyes.
|
Hazard Class | IRRITANT |
3,5-Dimethyl-4-isoxazolemethanol - Introduction
(3,5-dimethy1-4-isoxazolyl) METHANOL, also known as DMF or DMT, is an organic compound. Its molecular formula is C5H9NO and its molecular weight is 99.13g/mol.
(3,5-dimethyl-4-isoxazolyl) METHANOL has the following properties:
1. Appearance: colorless to light yellow liquid.
2. Solubility: Soluble in water, ethanol, ether and most organic solvents.
3. Melting Point:-61 ℃.
4. Boiling point: 153 ℃.
5. Density: 0.951 g/mL.
6. Flash point: 41 ° C.
7. Nature: a pungent smell.
(3,5-dimethyl-4-isoxazolyl) METHANOL's main purpose:
1. As a solvent: Because of its good solubility, it is widely used as a solvent in the chemical industry, especially for synthetic textile fibers, plastics, rubber, drugs and dyes.
2. As a catalyst: (3,5-dimethyl-4-isoxazolyl) METHANOL can be used as a catalyst for certain chemical reactions.
3. As a synthetic raw material: can be used as a synthetic raw material for some compounds, such as synthetic dyes, pesticides, pesticides, etc.
The preparation method of (3,5-dimethyl-4-isoxazolyl) METHANOL mainly includes:
1. DMF solvent method: prepared by reacting isoxazole with methanol under acidic conditions.
2. DMF gas phase method: prepared by reacting isoxazole with methanol vapor at high temperature.
Safety information about (3,5-dimethyl-4-isoxazolyl) METHANOL:
1. Toxicity: (3,5-dimethyl-4-isoxazolyl) METHANOL has certain toxicity and irritation to human body.
2. Flammability: (3,5-dimethyl-4-isoxazolyl) METHANOL is a flammable liquid with a risk of fire and explosion.
3. Storage precautions: should be stored in a cool, well-ventilated place, avoid contact with fire. Personal protective equipment such as protective gloves, glasses and protective masks should be worn during use.
Last Update:2024-04-09 21:54:55