3,6-Dichloro-2-pyridinecarboxaldehyde - Names and Identifiers
Name | 2-Pyridinecarboxaldehyde, 3,6-dichloro-
|
Synonyms | 3,6-Dichloropicolinaldehyde 3,6-dichloropyridine-2-carbaldehyde 2,5-dichloro-6-Pyridinecarboxaldehyde 2,5-Dichloropyridine-6-carboxaldehyde 3,6-Dichloro-2-pyridinecarboxaldehyde 3,6-Dichloropyridine-2-carboxaldehyde 2-Pyridinecarboxaldehyde, 3,6-dichloro- 3,6-Dichloro-2-formylpyridine, 3,6-Dichloropicolinaldehyde
|
CAS | 343781-53-3
|
InChI | InChI=1/C6H3Cl2NO/c7-4-1-2-6(8)9-5(4)3-10/h1-3H |
3,6-Dichloro-2-pyridinecarboxaldehyde - Physico-chemical Properties
Molecular Formula | C6H3Cl2NO
|
Molar Mass | 176 |
Density | 1.488 |
Boling Point | 234℃ |
Flash Point | 95℃ |
Vapor Presure | 0.054mmHg at 25°C |
pKa | -1.60±0.10(Predicted) |
Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
Refractive Index | 1.608 |
3,6-Dichloro-2-pyridinecarboxaldehyde - Risk and Safety
3,6-Dichloro-2-pyridinecarboxaldehyde - Introduction
2-Pyridinecarboxaldehyde, 3,6-dichloro-, chemical formula C7H4Cl2NO, is an organic compound. Its nature is as follows:
1. Appearance: 2-Pyridinecarboxaldehyde, 3,6-dichloro-is a colorless to pale yellow liquid.
2. Solubility: Soluble in organic solvents such as ethanol and ether, insoluble in water.
3. melting point: about 8-10 ℃.
4. boiling point: about 195-197 ℃.
2-Pyridinecarboxaldehyde, 3,6-dichloro-has a variety of uses, including:
1. chemical synthesis: it can be used as raw materials and intermediates in organic synthesis, participate in a variety of reactions such as C- C bond formation and C- N bond formation.
2. chemical analysis: it can be used as an analytical reagent, such as for the detection of metal ions.
3. Pesticide: 2-Pyridinecarboxaldehyde, 3,6-dichloro-can be used in agricultural fields as fungicides and insecticides.
4. Drug development: It may be used as an important compound in the drug development process for the design and synthesis of drugs.
A common method for preparing 2-Pyridinecarboxaldehyde, 3,6-dichloro-is by reacting 2,5-dichloropyridine and formaldehyde. The common reaction conditions are carried out under acidic conditions.
Regarding safety information, 2-Pyridinecarboxaldehyde, 3,6-dichloro-is an organic compound, and the following safety precautions need to be paid attention:
1. toxicity: for the human body, 2-Pyridinecarboxaldehyde, 3,6-dichloro-has a certain toxicity, direct contact or inhalation may cause harm to health.
2. fire danger: 2-Pyridinecarboxaldehyde, 3,6-dichloro-is a flammable liquid, avoid contact with open flame or high temperature, and keep away from fire sources during storage.
3. Personal protective measures: When handling 2-Pyridinecarboxaldehyde, 3,6-dichloro-, it is necessary to wear appropriate protective gloves, glasses and protective clothing to ensure safe operation.
4. Storage and handling: When storing 2-Pyridinecarboxalhyde, 3,6-dichloro-, it should be sealed and stored in a cool, dry place, and avoid contact with oxidants and strong acids. Waste disposal shall comply with relevant regulations.
When using and handling 2-Pyridinecarboxaldehyde, 3,6-dichloro-, please be sure to follow relevant safety operation regulations and precautions to reduce potential risks.
Last Update:2024-04-09 21:21:28