3-(2-AMINOETHYL)-7-METHYLINDOLE
7-methyltryptamine
CAS: 14490-05-2
Molecular Formula: C11H14N2
3-(2-AMINOETHYL)-7-METHYLINDOLE - Names and Identifiers
| Name | 7-methyltryptamine |
| Synonyms | 7-Methyltryptamine 7-Metyhltryptamine 7-METHYLTRYPTAMINE 7-methyltryptamine RARECHEM AN KA 1426 7-methyl-1h-indole-3-ethanamin 7-METHYLTRYPTAMINE CRYSTALLINE 3-(2-AMINOETHYL)-7-METHYLINDOLE 7-methyl-1H-indole-3-ethylamine 3-(2-aminoethyl)-7-methyl-indol 2-(7-methyl-1H-indol-3-yl)ethanamine |
| CAS | 14490-05-2 |
| EINECS | 238-498-9 |
| InChI | InChI=1/C11H14N2/c1-8-3-2-4-10-9(5-6-12)7-13-11(8)10/h2-4,7,13H,5-6,12H2,1H3 |
3-(2-AMINOETHYL)-7-METHYLINDOLE - Physico-chemical Properties
| Molecular Formula | C11H14N2 |
| Molar Mass | 174.24 |
| Density | 1.126±0.06 g/cm3(Predicted) |
| Melting Point | 123-130 °C |
| Boling Point | 150-220 °C(Press: 0.03 Torr) |
| Flash Point | 192°C |
| Vapor Presure | 4.77E-05mmHg at 25°C |
| Appearance | powder |
| pKa | 17.51±0.30(Predicted) |
| Storage Condition | -20°C |
| Refractive Index | 1.65 |
3-(2-AMINOETHYL)-7-METHYLINDOLE - Risk and Safety
| WGK Germany | 3 |
| RTECS | NL4300000 |
| Hazard Class | IRRITANT |
3-(2-AMINOETHYL)-7-METHYLINDOLE - Introduction
7-methyltryptamine (also known as N,N-dimethylpropylamine) is an organic compound with the chemical formula C8H11N. The following is a description of its nature, use, preparation and safety information:
Nature:
1. Appearance: 7-methyltryptamine is a colorless liquid with a weak ammonia odor.
2. Density: The density of this compound is 0.852g/cm³.
3. Boiling point: its boiling point is 164-166 ° C.
4. Solubility: 7-methyltryptamine is soluble in organic solvents such as ethanol, ether and benzene.
Use:
1. 7-methyltryptamine is an important intermediate for the manufacture of dyes and pigments.
2. It can also be used as a synthetic raw material for certain drugs, such as antidepressants.
Method:
There are many preparation methods of 7-methyltryptamine, one of which is commonly used by the reaction of anpropylammonium chloride and dimethylamine. The specific steps are as follows:
1. Preparation of reactants: Propanammonium chloride and dimethylamine are prepared.
2. Reaction: In an appropriate solvent, enpropylammonium chloride and dimethylamine are slowly added to the reaction vessel, and the temperature and stirring speed should be controlled during the reaction.
3. Product isolation: After the reaction is completed, the product is isolated by an appropriate method.
Safety Information:
1. 7-methyltryptamine is irritating and should avoid direct contact with skin and eyes.
2. When using or storing 7-methyltryptamine, keep it well ventilated and avoid inhaling its vapor or dust.
3. Wear appropriate personal protective equipment, such as gloves, glasses and respirator.
4. Be careful when dealing with 7-methyltryptamine to avoid violent reactions with oxidants and strong acids to avoid accidents.
5. The use and storage of 7-methyltryptamine under strict control can reduce its potential risks.
Due to the different nature and use of chemicals, it is recommended to take appropriate safety measures during operation, and consult relevant professionals for more detailed and accurate information based on the actual situation.
Nature:
1. Appearance: 7-methyltryptamine is a colorless liquid with a weak ammonia odor.
2. Density: The density of this compound is 0.852g/cm³.
3. Boiling point: its boiling point is 164-166 ° C.
4. Solubility: 7-methyltryptamine is soluble in organic solvents such as ethanol, ether and benzene.
Use:
1. 7-methyltryptamine is an important intermediate for the manufacture of dyes and pigments.
2. It can also be used as a synthetic raw material for certain drugs, such as antidepressants.
Method:
There are many preparation methods of 7-methyltryptamine, one of which is commonly used by the reaction of anpropylammonium chloride and dimethylamine. The specific steps are as follows:
1. Preparation of reactants: Propanammonium chloride and dimethylamine are prepared.
2. Reaction: In an appropriate solvent, enpropylammonium chloride and dimethylamine are slowly added to the reaction vessel, and the temperature and stirring speed should be controlled during the reaction.
3. Product isolation: After the reaction is completed, the product is isolated by an appropriate method.
Safety Information:
1. 7-methyltryptamine is irritating and should avoid direct contact with skin and eyes.
2. When using or storing 7-methyltryptamine, keep it well ventilated and avoid inhaling its vapor or dust.
3. Wear appropriate personal protective equipment, such as gloves, glasses and respirator.
4. Be careful when dealing with 7-methyltryptamine to avoid violent reactions with oxidants and strong acids to avoid accidents.
5. The use and storage of 7-methyltryptamine under strict control can reduce its potential risks.
Due to the different nature and use of chemicals, it is recommended to take appropriate safety measures during operation, and consult relevant professionals for more detailed and accurate information based on the actual situation.
Last Update：2024-04-09 15:17:52
