3-(4-bromophenoxy)-N,N-dimethylpropan-1-amine
3-(2-bromophenoxy)-N,N-dimethylpropan-1-amine
CAS: 76579-64-1
Molecular Formula: C11H16BrNO
3-(4-bromophenoxy)-N,N-dimethylpropan-1-amine - Names and Identifiers
| Name | 3-(2-bromophenoxy)-N,N-dimethylpropan-1-amine |
| Synonyms | 2-[3-(Dimethylamino)propoxy]bromobenzene 3-(4-Bromophenoxy)-N,N-dimethylpropylamine 3-(4-broMophenoxy)-N,N-diMethylpropan-1-aMine 3-(4-bromophenoxy)-N,N-dimethylpropan-1-amine 3-(2-bromophenoxy)-N,N-dimethylpropan-1-amine 1-Propanamine, 3-(4-bromophenoxy)-N,N-dimethyl- |
| CAS | 76579-64-1 |
| InChI | InChI=1/C11H16BrNO/c1-13(2)8-5-9-14-11-7-4-3-6-10(11)12/h3-4,6-7H,5,8-9H2,1-2H3 |
3-(4-bromophenoxy)-N,N-dimethylpropan-1-amine - Physico-chemical Properties
| Molecular Formula | C11H16BrNO |
| Molar Mass | 258.15 |
| Density | 1.272g/cm3 |
| Boling Point | 305.8°C at 760 mmHg |
| Flash Point | 138.7°C |
| Vapor Presure | 0.000804mmHg at 25°C |
| Refractive Index | 1.532 |
3-(4-bromophenoxy)-N,N-dimethylpropan-1-amine - Risk and Safety
| Hazard Symbols | C - Corrosive |
| Hazard Note | Corrosive |
3-(4-bromophenoxy)-N,N-dimethylpropan-1-amine - Introduction
3-(2-bromophenoxy)-N,N-dimethylpropan-1-amine is an organic compound with the chemical formula C11H16BrNO and a molecular weight of 257.16g/mol.
Its properties include:
1. appearance: colorless to light yellow liquid.
2. Melting point:-24 to -23 degrees Celsius.
3. Boiling point: 246 degrees Celsius.
4. density: about 1.27 g/ml.
5. Solubility: Soluble in organic solvents such as ethanol, ether and chloroform.
The main uses of the compound are:
1. as a drug intermediate: can be used for the synthesis of anxiolytic drugs, antidepressant drugs, antiarrhythmic drugs.
2. as a chemical reagent: can be used in organic synthesis reaction of oxidation, reduction reaction.
The method of preparing 3-(2-bromophenoxy)-N,N-dimethylpropan-1-amine is usually carried out by the following steps:
1. The N,N-dimethyl-N-(2-propyl) alcohol amine reacts with 4-bromophenol to generate 3-(2-bromophenoxy)-N,N-dimethylpropan-1-amine.
Regarding the safety information of this compound, the following matters need to be noted:
1. 3-(2-bromophenoxy)-N,N-dimethylpropan-1-amine may be irritating to skin, eyes and mucous membranes, should wear appropriate protective measures when using.
2. Avoid inhaling the vapor or dust of the compound during operation to avoid poisoning.
3. During use and storage, the compound should be kept away from combustibles and heat sources.
4. Local environmental regulations should be observed when disposing of the waste of this compound.
Its properties include:
1. appearance: colorless to light yellow liquid.
2. Melting point:-24 to -23 degrees Celsius.
3. Boiling point: 246 degrees Celsius.
4. density: about 1.27 g/ml.
5. Solubility: Soluble in organic solvents such as ethanol, ether and chloroform.
The main uses of the compound are:
1. as a drug intermediate: can be used for the synthesis of anxiolytic drugs, antidepressant drugs, antiarrhythmic drugs.
2. as a chemical reagent: can be used in organic synthesis reaction of oxidation, reduction reaction.
The method of preparing 3-(2-bromophenoxy)-N,N-dimethylpropan-1-amine is usually carried out by the following steps:
1. The N,N-dimethyl-N-(2-propyl) alcohol amine reacts with 4-bromophenol to generate 3-(2-bromophenoxy)-N,N-dimethylpropan-1-amine.
Regarding the safety information of this compound, the following matters need to be noted:
1. 3-(2-bromophenoxy)-N,N-dimethylpropan-1-amine may be irritating to skin, eyes and mucous membranes, should wear appropriate protective measures when using.
2. Avoid inhaling the vapor or dust of the compound during operation to avoid poisoning.
3. During use and storage, the compound should be kept away from combustibles and heat sources.
4. Local environmental regulations should be observed when disposing of the waste of this compound.
Last Update：2024-04-09 19:05:52
