3-(chloromethyl)pentane
3-(chloromethyl)pentane
CAS: 4737-41-1
Molecular Formula: C6H13Cl
3-(chloromethyl)pentane - Names and Identifiers
| Name | 3-(chloromethyl)pentane |
| Synonyms | 2-ethylbutylchloride 1-Chloro-2-ethylbutane 1-chloro-2-ethylbutane 3-(chloromethyl)pentane 3-(CHLOROMETHYL)PENTANE 3-(chloromethyl)-pentan butane,1-chloro-2-ethyl- Pentane, 3-(chloromethyl) Pentane,3-(chloromethyl)- Pentane, 3-(chloromethyl)- |
| CAS | 4737-41-1 |
| InChI | InChI=1/C6H13Cl/c1-3-6(4-2)5-7/h6H,3-5H2,1-2H3 |
3-(chloromethyl)pentane - Physico-chemical Properties
| Molecular Formula | C6H13Cl |
| Molar Mass | 120.62 |
| Density | 0.891 g/mL at 25 °C (lit.) |
| Melting Point | -35.1°C (estimate) |
| Boling Point | 126-128 °C/753 mmHg (lit.) |
| Flash Point | 66°F |
| Vapor Presure | 15mmHg at 25°C |
| Refractive Index | n20/D 1.423(lit.) |
3-(chloromethyl)pentane - Risk and Safety
| Hazard Symbols | F - Flammable |
| Risk Codes | 11 - Highly Flammable |
| UN IDs | UN 1993 3/PG 2 |
| WGK Germany | 3 |
