3-Amino-6-methylpyridazin...
6-Methylpyridazin-3-amine
CAS: 18591-82-7
Molecular Formula: C5H7N3
3-Amino-6-methylpyridazin... - Names and Identifiers
| Name | 6-Methylpyridazin-3-amine |
| Synonyms | 6-iodopyridazin-3-amine 3-Ami-6-methylpyridazine 6-METHYLPYRIDAZIN-3-AMINE 6-Methyl-3-pyridazinamine 6-Methylpyridazin-3-amine 6-methyl-3-aminopyridazine 3-Amino-6-Methylpyridazine 3-AMINO-6-METHYLPYRIDAZINE 3-Amino-6-methylpyridazin... 6-methylpyridazine-3-ylamine 6-Methylpyridazin-3-amine, tech |
| CAS | 18591-82-7 |
| EINECS | 242-430-3 |
| InChI | InChI=1/C4H4IN3/c5-3-1-2-4(6)8-7-3/h1-2H,(H2,6,8) |
3-Amino-6-methylpyridazin... - Physico-chemical Properties
| Molecular Formula | C5H7N3 |
| Molar Mass | 109.13 |
| Density | 1.155 |
| Melting Point | 222-223℃ |
| Boling Point | 319℃ |
| Flash Point | 173℃ |
| Vapor Presure | 1.35E-06mmHg at 25°C |
| pKa | 5.48±0.10(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.719 |
3-Amino-6-methylpyridazin... - Risk and Safety
| Hazard Symbols | Xn - Harmful |
| Risk Codes | 22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| Hazard Class | IRRITANT |
3-Amino-6-methylpyridazin... - Introduction
6-Methylpyridazin-3-amine is an organic compound with the chemical formula C5H8N4. The following is a brief description of the properties, uses, preparation and safety information of the compound:
Nature:
1. Appearance: 6-Methylpyridazin-3-amine is a colorless crystalline solid.
2. Melting Point: about 300-302 degrees Celsius.
3. Solubility: soluble in water, alcohol and chloroform, slightly soluble in ether, almost insoluble in petroleum ether.
Use:
1. As a chemical reagent: 6-methylpyriridazin-3-amine is often used as a catalyst, peroxide reducing agent, solvent and intermediate of organic synthesis reaction in organic synthesis.
2. Medical field: it is also used in the synthesis of some drugs.
Method:
6-Methylpyridazin-3-amine can be prepared by the following steps:
1. At high temperature, boric acid and calcium nitride react to obtain polyurethane precursor.
2. The polyurethane precursor is further reacted and hydrolyzed to finally obtain 6-methylpyriridazin-3-amine.
Safety Information:
1. The safety data of 6-Methylpyridazin-3-amine is limited, so it needs to be used with caution.
2. It may be irritating to the skin and eyes, and protective measures should be taken when using it.
3. Avoid inhalation or ingestion of the compound, ensure that the work environment is well ventilated, and take appropriate personal protective measures.
4. During storage and handling, avoid contact with oxidants and strong acids to avoid unnecessary chemical reactions and dangers.
Nature:
1. Appearance: 6-Methylpyridazin-3-amine is a colorless crystalline solid.
2. Melting Point: about 300-302 degrees Celsius.
3. Solubility: soluble in water, alcohol and chloroform, slightly soluble in ether, almost insoluble in petroleum ether.
Use:
1. As a chemical reagent: 6-methylpyriridazin-3-amine is often used as a catalyst, peroxide reducing agent, solvent and intermediate of organic synthesis reaction in organic synthesis.
2. Medical field: it is also used in the synthesis of some drugs.
Method:
6-Methylpyridazin-3-amine can be prepared by the following steps:
1. At high temperature, boric acid and calcium nitride react to obtain polyurethane precursor.
2. The polyurethane precursor is further reacted and hydrolyzed to finally obtain 6-methylpyriridazin-3-amine.
Safety Information:
1. The safety data of 6-Methylpyridazin-3-amine is limited, so it needs to be used with caution.
2. It may be irritating to the skin and eyes, and protective measures should be taken when using it.
3. Avoid inhalation or ingestion of the compound, ensure that the work environment is well ventilated, and take appropriate personal protective measures.
4. During storage and handling, avoid contact with oxidants and strong acids to avoid unnecessary chemical reactions and dangers.
Last Update：2024-04-09 20:49:11
