3-Borono-5-fluoro-2-methoxypyridine

3-Borono-5-fluoro-2-methoxypyridine - Names and Identifiers

Name	(5-Fluoro-2-methoxypyridin-3-yl)boronic acid
Synonyms	3-Borono-5-fluoro-2-methoxypyridine 5-fluoro-2-methoxy-3-pyridineboronic acid 5-Fluoro-2-methoxypyridine-3-boronic acid 5-Fluoro-2-methoxypyridin-3-ylboronic acid (5-fluoro-2-methoxypyridin-3-yl)boronicaci (5-Fluoro-2-methoxypyridin-3-yl)boronic acid Boronicacid,B-(5-fluoro-2-methoxy-3-pyridinyl)
CAS	957120-32-0
EINECS	200-589-5
InChI	InChI=1S/C6H7BFNO3/c1-12-6-5(7(10)11)2-4(8)3-9-6/h2-3,10-11H,1H3

3-Borono-5-fluoro-2-methoxypyridine - Physico-chemical Properties

Molecular Formula	C6H7BFNO3
Molar Mass	170.93
Density	1.34
Boling Point	327.6 °C at 760 mmHg
Flash Point	151.9 °C
Storage Condition	2-8°C

3-Borono-5-fluoro-2-methoxypyridine - Introduction

boronic acid is an organic compound with the chemical formula C6H6BFNO3. Its nature is as follows:

1. Appearance: colorless to light yellow crystal or powder.
2. solubility: soluble in some organic solvents such as ethanol and dimethyl sulfoxide, slightly soluble in water.
3. melting point: about 220 ℃-223 ℃.
4. density: about 1.3 g/cm.

(Br) The main use of boronic acid is as an important intermediate in organic synthesis. It can be used to synthesize other compounds, such as drugs, pesticides, coordination compounds, etc. Due to the introduction of boronic acid groups, it can participate in various organic synthesis reactions, such as cross-coupling reactions, C- H activation reactions, etc., with high chemical activity.

The method of preparing (r) boronic acid is as follows:

5-fluoro-2-methoxypyridine was combined with tert-butanol using sodium hydroxide as a base catalyst, and the corresponding tert-butanol ester intermediate was obtained after the reaction. The tert-butyl alcohol ester is then reacted with boronic acid to form the boronic acid.

Please pay attention to the following safety information during use:

1. boronic acid may be irritating to the eyes, skin and respiratory system, please avoid contact.
2. During operation, please wear appropriate personal protective equipment, such as laboratory gloves, safety glasses and protective clothing.
3. Please operate in a well-ventilated environment to avoid inhaling gas, steam or dust.
4. If you come into contact with this compound, rinse immediately with plenty of water and seek medical help.
5. In the storage and handling of the compound, please comply with the local safety practices, avoid fire and static electricity.

Please note that this is only a general introduction to the compound, and more detailed evaluation and operation are required according to the actual situation in the specific research and application.

Last Update：2024-04-09 21:04:16