3-Chloro-6-(1H-imidazol-1-yl)pyridazine
3-Chloro-6-(1H-imidazol-1-yl)pyridazine
CAS: 71037-71-3
Molecular Formula: C7H5ClN4
3-Chloro-6-(1H-imidazol-1-yl)pyridazine - Names and Identifiers
| Name | 3-Chloro-6-(1H-imidazol-1-yl)pyridazine |
| Synonyms | Albb-005028 1-(6-Chloropyridazin-3-yl)1H-indazole 3-Chloro-6-(1H-imidazol-1-yl)pyridazine Pyridazine, 3-chloro-6-(imidazol-1-yl)- Pyridazine, 3-chloro-6-(1H-imidazol-1-yl)- pyridazine, 3-chloro-6-(1H-imidazol-1-yl)- |
| CAS | 71037-71-3 |
| InChI | InChI=1/C7H5ClN4/c8-6-1-2-7(11-10-6)12-4-3-9-5-12/h1-5H |
3-Chloro-6-(1H-imidazol-1-yl)pyridazine - Physico-chemical Properties
| Molecular Formula | C7H5ClN4 |
| Molar Mass | 180.59 |
| Density | 1.47g/cm3 |
| Boling Point | 416.4°C at 760 mmHg |
| Flash Point | 205.6°C |
| Vapor Presure | 9.26E-07mmHg at 25°C |
| Storage Condition | 2-8°C |
| Sensitive | Irritant |
| Refractive Index | 1.702 |
| MDL | MFCD02323226 |
3-Chloro-6-(1H-imidazol-1-yl)pyridazine - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Hazard Note | Irritant |
3-Chloro-6-(1H-imidazol-1-yl)pyridazine - Introduction
3-Chloro-6-(1H-imidazol-1-yl)pyridazine is an organic compound with the chemical formula C8H5ClN4. Its nature is as follows:
Appearance: White to light yellow solid.
Solubility: Soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dichloromethane (DCM).
Uses: 3-Chloro-6-(1H-imidazol-1-yl)pyridazine can be used as pharmaceutical and pesticide intermediates. It can be used in the synthesis of biologically active compounds, such as pyridazine antitumor drugs.
preparation method: 3-Chloro-6-(1H-imidazol-1-yl)pyridazine has many preparation methods, and the common methods include:
1. Using 3-chloropyridazine and imidazole as raw materials, prepared by nucleophilic substitution reaction.
2. 6-bromo-3-chloropyridazine is reacted with imidazole under alkaline conditions.
Safety Information: 3-Chloro-6-(1H-imidazol-1-yl)pyridazine has limited toxicity information, but as an organic compound, it is generally necessary to follow safe practices and use protective measures to avoid inhalation, ingestion, or skin contact. Appropriate protective equipment such as goggles, gloves and protective clothing should be used for laboratory or industrial operations.
Appearance: White to light yellow solid.
Solubility: Soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dichloromethane (DCM).
Uses: 3-Chloro-6-(1H-imidazol-1-yl)pyridazine can be used as pharmaceutical and pesticide intermediates. It can be used in the synthesis of biologically active compounds, such as pyridazine antitumor drugs.
preparation method: 3-Chloro-6-(1H-imidazol-1-yl)pyridazine has many preparation methods, and the common methods include:
1. Using 3-chloropyridazine and imidazole as raw materials, prepared by nucleophilic substitution reaction.
2. 6-bromo-3-chloropyridazine is reacted with imidazole under alkaline conditions.
Safety Information: 3-Chloro-6-(1H-imidazol-1-yl)pyridazine has limited toxicity information, but as an organic compound, it is generally necessary to follow safe practices and use protective measures to avoid inhalation, ingestion, or skin contact. Appropriate protective equipment such as goggles, gloves and protective clothing should be used for laboratory or industrial operations.
Last Update：2024-04-09 18:58:34
