3-Hydroxy-3-(trifluoromethyl)
3-hydroxy-3-(trifluoromethyl)cyclobutanecarboxylic acid
CAS: 1163729-49-4
Molecular Formula: C6H7F3O3
3-Hydroxy-3-(trifluoromethyl) - Names and Identifiers
3-Hydroxy-3-(trifluoromethyl) - Physico-chemical Properties
| Molecular Formula | C6H7F3O3 |
| Molar Mass | 184.11 |
| Density | 1.648±0.06 g/cm3(Predicted) |
| Boling Point | 252.8±40.0 °C(Predicted) |
| pKa | 4.11±0.40(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
3-Hydroxy-3-(trifluoromethyl) - Introduction
3-Hydroxy-3-trifluoromethylcyclobutanecarboxylic acid, chemical formula CF3CH2C(CH2COOH)(CH2OH)2. The following is a description of its nature, use, preparation and safety information:
Nature:
1. appearance: colorless or light yellow liquid.
2. Solubility: Soluble in water and most organic solvents.
3. melting point: about 30-40 ℃.
4. Stability: The compound is stable at room temperature.
Use:
3-hydroxy-3-trifluoromethylcyclobutanecarboxylic acid has good surface active properties and can be used as a high-efficiency surfactant and emulsifier. In the chemical industry, it is often used to prepare coatings, detergents, moisture absorbents and other products.
Method:
3-hydroxy-3-trifluoromethylcyclobutanecarboxylic acid can be prepared by the following steps:
1. First, 2,2,3,3-tetrafluoropropionitrile and cyclopentanone are reacted in the presence of a base to produce 3-hydroxy-3-trifluoromethylcyclobutanone.
2. Then, 3-hydroxy-3-trifluoromethylcyclobutanone is reacted with chloroformic acid to produce 3-hydroxy-3-trifluoromethylcyclobutanecarboxylic acid.
Safety Information:
1. Avoid contact with skin and eyes when using, avoid inhalation or intake.
2. avoid contact with strong oxidants, strong acids and strong bases.
3. need to be sealed when stored, avoid light and high temperature.
4. In case of accidental exposure or ingestion, seek medical attention immediately and bring a chemical container or label.
Nature:
1. appearance: colorless or light yellow liquid.
2. Solubility: Soluble in water and most organic solvents.
3. melting point: about 30-40 ℃.
4. Stability: The compound is stable at room temperature.
Use:
3-hydroxy-3-trifluoromethylcyclobutanecarboxylic acid has good surface active properties and can be used as a high-efficiency surfactant and emulsifier. In the chemical industry, it is often used to prepare coatings, detergents, moisture absorbents and other products.
Method:
3-hydroxy-3-trifluoromethylcyclobutanecarboxylic acid can be prepared by the following steps:
1. First, 2,2,3,3-tetrafluoropropionitrile and cyclopentanone are reacted in the presence of a base to produce 3-hydroxy-3-trifluoromethylcyclobutanone.
2. Then, 3-hydroxy-3-trifluoromethylcyclobutanone is reacted with chloroformic acid to produce 3-hydroxy-3-trifluoromethylcyclobutanecarboxylic acid.
Safety Information:
1. Avoid contact with skin and eyes when using, avoid inhalation or intake.
2. avoid contact with strong oxidants, strong acids and strong bases.
3. need to be sealed when stored, avoid light and high temperature.
4. In case of accidental exposure or ingestion, seek medical attention immediately and bring a chemical container or label.
Last Update：2024-04-10 22:29:15
Supplier List
Product Name: 3-Hydroxy-3-(trifluoroMet... Visit Supplier Webpage Request for quotation
CAS: 1163729-49-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 1163729-49-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 3-Hydroxy-3-(trifluoroMet... Visit Supplier Webpage Request for quotation
CAS: 1163729-49-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 1163729-49-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History