3-METHYL-4-NITROBENZALDEHYDE

3-METHYL-4-NITROBENZALDEHYDE - Names and Identifiers

Name	3-METHYL-4-NITROBENZALDEHYDE
Synonyms	3-METHYL-4-NITROBENZALDEHYDE Benzaldehyde, 3-methyl-4-nitro- 5-Formyl-2-nitrotoluene, 4-Formyl-2-methylnitrobenzene
CAS	18515-67-8
InChI	InChI=1/C8H7NO3/c1-6-4-7(5-10)2-3-8(6)9(11)12/h2-5H,1H3

3-METHYL-4-NITROBENZALDEHYDE - Physico-chemical Properties

Molecular Formula	C8H7NO3
Molar Mass	165.15
Density	1.278±0.06 g/cm3(Predicted)
Boling Point	304.4±30.0 °C(Predicted)
Flash Point	151.2°C
Vapor Presure	0.000877mmHg at 25°C
Storage Condition	under inert gas (nitrogen or Argon) at 2-8°C
Refractive Index	1.602

3-METHYL-4-NITROBENZALDEHYDE - Introduction

3-methyll-4-nitrobenzaldehyde, chemical formula C8H7NO3, is an organic compound with the following properties:

1. Appearance: 3-METHYL-4-NITROBENZALDEHYDE is yellow crystalline solid or orange needle crystal.
2. Solubility: It is easy to dissolve in common organic solvents such as ethanol and methanol, and the solubility is small.
3. Melting point: The melting point is about 71-72 ° C.
4. Stability: The compound is sensitive to light and air, and is easy to oxidize and decompose.

3-METHYL-4-NITROBENZALDEHYDE has the following main uses:

1. Intermediate: It is an important intermediate for the synthesis of dyes and organic synthetic compounds.
2. Pharmaceutical field: It is used to synthesize certain drugs, such as antibacterial drugs, anticancer drugs, etc.
3. Preservatives: can be used as preservatives to prevent food, drugs and cosmetics products such as microbial contamination.

The preparation method of 3-methyll-4-nitrobenzaldehyde includes the following steps:

1. Oxidation: through the oxidation reaction of methyl benzene formaldehyde, commonly used oxidants are nitric acid, boric acid and so on.
2. Nitration: the product obtained after oxidation reacts with nitric acid to introduce nitro groups.
3. Crystallization: The product obtained by the reaction is purified by crystallization to obtain the final product.

When using and operating 3-methyll-4-nitrobenzaldehyde, you need to pay attention to the following safety information:

1. Toxicity: The compound has certain toxicity, contact or inhalation may be harmful to health.
2. Irritation: May cause irritation to eyes, skin and respiratory tract, direct contact should be avoided.
3. Protective measures: in preparation or use, should wear appropriate protective equipment, such as gloves, goggles and protective mask.
4. Storage: It should be stored in a sealed container, away from fire and flammable materials.

Before using 3-methyll-4-nitrobenzaldehyde, you should understand the safe operation guidelines of the substance in detail and follow the correct operating procedures.

Last Update：2024-04-09 21:21:28