3-aMino-5-broMo-4-Methoxypyridine

3-aMino-5-broMo-4-Methoxypyridine - Names and Identifiers

Name	5-bromo-4-methoxy-pyridin-3-amine
Synonyms	5-Bromo-4-methoxy-3-pyridinamine 5-BROMO-4-METHOXYPYRIDIN-3-AMINE 5-bromo-4-methoxypyridin-3-amine 3-aMino-5-broMo-4-Methoxypyridine 5-bromo-4-methoxy-pyridin-3-amine 3-Amino-4-methoxy-5-bromopyridine 3-Pyridinamine, 5-bromo-4-methoxy- 3-pyridinamine, 5-bromo-4-methoxy- 5-Bromo-4-methoxy-pyridin-3-ylamine
CAS	31872-78-3
InChI	InChI=1/C6H7BrN2O/c1-10-6-4(7)2-9-3-5(6)8/h2-3H,8H2,1H3

3-aMino-5-broMo-4-Methoxypyridine - Physico-chemical Properties

Molecular Formula	C6H7BrN2O
Molar Mass	203.04
Density	1.622
Boling Point	304℃
Flash Point	138℃
Vapor Presure	0.000892mmHg at 25°C
pKa	5.11±0.28(Predicted)
Storage Condition	Keep in dark place,Inert atmosphere,Room temperature
Refractive Index	1.602

3-aMino-5-broMo-4-Methoxypyridine - Introduction

The chemical formula is C6H7BrN2O, which is an organic compound. It has the following properties:

1. Appearance: Colorless to pale yellow crystalline solid.
2. Melting Point: about 160-164 degrees Celsius.
3. Solubility: Good solubility in common organic solvents, such as methanol, ethanol, dimethyl sulfoxide, etc.
4. Acid and alkali: is a weak base, can react with acid to generate salt.

This compound has a wide range of applications in organic synthesis, including:

1. Drug research: It can be used as an intermediate or starting material for the synthesis of biologically active compounds, such as drugs or biomarkers.
2. Pesticide manufacturing: It is used as one of the intermediates or starting materials in the synthesis of pesticides or agricultural chemicals.
3. Dye synthesis: It can be used to synthesize dyes and pigments for textile, paint and other color manufacturing processes.

The preparation method can be carried out by the following steps:

1. Add 3-bromo-5-methoxypyridine and an amino compound (such as ammonia water) to a reaction vessel.
2. The reaction is carried out at an appropriate temperature, which usually requires a longer reaction time.
3. The reaction conditions are controlled so that the target compound can be efficiently produced by the reaction.
4. After the reaction, the target product is obtained by the steps of crystallization, filtration and drying.

When using, pay attention to the following safety information:

1. Avoid contact with skin, eyes and mucous membranes. In case of contact, rinse immediately with plenty of water and seek medical help.
2. During use, wear appropriate personal protective equipment, such as laboratory gloves, protective glasses and laboratory coats.
3. Avoid inhaling the dust or gas of the compound. Good ventilation should be maintained during operation.
4. When storing, the compound should be stored in a sealed container, away from fire and high temperature, and avoid contact with oxidants or combustibles.

In addition, read and follow relevant safe operating procedures and laboratory regulations before use.

Last Update：2024-04-09 21:21:28