3-ethylthiopropane-1,2-diol
3-ethylthiopropane-1,2-diol
CAS: 60763-78-2
Molecular Formula: C5H12O2S
3-ethylthiopropane-1,2-diol - Names and Identifiers
| Name | 3-ethylthiopropane-1,2-diol |
| Synonyms | 3-ethylthiopropane-1,2-diol |
| CAS | 60763-78-2 |
| EINECS | 262-419-7 |
| InChI | InChI=1/C5H12O2S/c1-2-8-4-5(7)3-6/h5-7H,2-4H2,1H3/t5-/m0/s1 |
3-ethylthiopropane-1,2-diol - Physico-chemical Properties
| Molecular Formula | C5H12O2S |
| Molar Mass | 136.21 |
| Density | 1.0900 |
| Boling Point | 220.52°C (rough estimate) |
| Flash Point | 133°C |
| Vapor Presure | 0.000785mmHg at 25°C |
| Refractive Index | 1.5065 (estimate) |
3-ethylthiopropane-1,2-diol - Introduction
3-ethylthiopropane-1,2-diol is an organic compound with the chemical formula C5H12OS, and the structure contains a propylene glycol group and an ethylthio group. The following is a description of the properties, uses, preparation and safety information of this compound:
Nature:
1. appearance: colorless to yellow liquid.
2. melting point: about -15 ℃.
3. Boiling point: about 180-182 ℃.
4. Solubility: Soluble in water and most organic solvents.
Use:
1. Chemical synthesis: 3-ethylthiopropane-1,2-diol can be used as a synthetic intermediate in organic synthesis reactions.
2. Preservative: Due to its antibacterial and antioxidant properties, it can be used as a preservative and antioxidant in the cosmetics, pharmaceutical and food industries.
3. oral fragrance: as one of the active ingredients in oral cleaning products.
Preparation Method:
3-ethylthiopropane-1,2-diol is usually prepared by the following steps:
1.3-chloro-1, 2-propanediol reacts with thiopropanol to generate 3-ethylthiopropane-1,2-diol.
Safety Information:
1.3-Ethylthiopropane-1, 2-diol is irritating and corrosive, please avoid contact with skin and eyes. Use personal protective equipment when necessary.
2. If inhaled or ingested, seek medical attention immediately.
3. It should be stored in a cool, well-ventilated place, and away from heat sources and open flames.
4. When using, please follow the correct operating procedures and safe operating methods.
Nature:
1. appearance: colorless to yellow liquid.
2. melting point: about -15 ℃.
3. Boiling point: about 180-182 ℃.
4. Solubility: Soluble in water and most organic solvents.
Use:
1. Chemical synthesis: 3-ethylthiopropane-1,2-diol can be used as a synthetic intermediate in organic synthesis reactions.
2. Preservative: Due to its antibacterial and antioxidant properties, it can be used as a preservative and antioxidant in the cosmetics, pharmaceutical and food industries.
3. oral fragrance: as one of the active ingredients in oral cleaning products.
Preparation Method:
3-ethylthiopropane-1,2-diol is usually prepared by the following steps:
1.3-chloro-1, 2-propanediol reacts with thiopropanol to generate 3-ethylthiopropane-1,2-diol.
Safety Information:
1.3-Ethylthiopropane-1, 2-diol is irritating and corrosive, please avoid contact with skin and eyes. Use personal protective equipment when necessary.
2. If inhaled or ingested, seek medical attention immediately.
3. It should be stored in a cool, well-ventilated place, and away from heat sources and open flames.
4. When using, please follow the correct operating procedures and safe operating methods.
Last Update：2024-04-09 02:00:47
