304858-67-1

304858-67-1 - Names and Identifiers

Name	3-cyano-5-fluorophenylboronic acid
Synonyms	3-Borono-5-fluorobenzonitrile 3-cyano-5-fluorophenylboronicacid 3-Fluoro-5-cyanophenylboronic acid 3-cyano-5-fluorophenylboronic acid 3-Cyano-5-fluorobenzeneboronic acid Boronic acid, B-(3-cyano-5-fluorophenyl)- Boronic acid, (3-cyano-5-fluorophenyl)- (9CI)
CAS	304858-67-1
InChI	InChI=1/C7H5BFNO2/c9-7-2-5(4-10)1-6(3-7)8(11)12/h1-3,11-12H

304858-67-1 - Physico-chemical Properties

Molecular Formula	C7H5BFNO2
Molar Mass	164.93
Density	1.35
Boling Point	343.2±52.0 °C(Predicted)
Flash Point	161.335°C
Vapor Presure	0mmHg at 25°C
Appearance	Crystalline powder
Color	White
pKa	6.14±0.10(Predicted)
Storage Condition	under inert gas (nitrogen or Argon) at 2-8°C
Refractive Index	1.535

304858-67-1 - Risk and Safety

HS Code

29310099

304858-67-1 - Introduction

acid, chemical formula C7H5BFNO2, is an organic compound. Its nature is as follows:

1. Appearance: acid is white crystal powder.
2. Solubility: it can be dissolved in common organic solvents such as dimethyl sulfoxide (DMSO) and ethyl acetate.
3. Chemical properties: acid is a boronic acid derivative, which can react with other compounds in a variety of organic reactions, such as condensation reactions, coupling reactions and nucleophilic substitution reactions.
4. Stability: It is stable under dry conditions, but may decompose in a humid environment.

m acid is widely used in organic synthesis, pharmaceutical chemistry and materials science. Its Main uses include:

1. Catalyst: It can be used as a precursor of metal catalysts and ligands for organic synthesis reactions, such as coupling reactions, selective addition reactions, etc.
2. Drug research: It can be used to synthesize and modify drug molecules to improve their solubility, activity and pharmacokinetics.
3. Functional materials: It can be used to prepare polymers, coatings and conductive materials with special properties.

acid preparation method is generally obtained by chemical synthesis, the specific steps can refer to the organic synthesis literature and related research papers.

Regarding safety information, there is no detailed research report on the specific toxicity and hazards of acid, so it is necessary to follow the general organic compound operating specifications and personal protective measures when using it, for example, wear gloves and goggles and operate under well-ventilated conditions. At the same time, avoid its contact with skin, eyes and inhalation of its powder. In the event of discomfort or accident, seek medical attention and provide detailed information about the compound to the doctor.

Last Update：2024-04-09 21:11:58