3074-71-3
2,3-dimethylheptane
CAS: 3074-71-3
Molecular Formula: C9H20
3074-71-3 - Names and Identifiers
| Name | 2,3-dimethylheptane |
| Synonyms | 2,3-dimethylheptane 2,3-DIMETHYLHEPTANE Heptane, 2,3-dimethyl- HEPTANE,2,3-DIMETHYL-(SUR) |
| CAS | 3074-71-3 |
| InChI | InChI=1/C9H20/c1-5-6-7-9(4)8(2)3/h8-9H,5-7H2,1-4H3 |
3074-71-3 - Physico-chemical Properties
| Molecular Formula | C9H20 |
| Molar Mass | 128.26 |
| Density | 0.726g/mLat 25°C(lit.) |
| Melting Point | -112.99°C |
| Boling Point | 140°C(lit.) |
| Flash Point | 195°F |
| Water Solubility | 251.2ug/L(temperature not stated) |
| Solubility | soluble in Ether,Alcohol,Benzene,Acetone |
| Vapor Presure | 7.54mmHg at 25°C |
| Refractive Index | n20/D 1.409(lit.) |
3074-71-3 - Risk and Safety
| UN IDs | 1920 |
| WGK Germany | 3 |
| Hazard Class | 3 |
| Packing Group | III |
3074-71-3 - Reference Information
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
Last Update：2024-04-10 22:29:15
