312693-42-8
(4-chloro-3-fluoro-phenyl)-iodo-zinc
CAS: 312693-42-8
Molecular Formula: C6H3ClFIZn
312693-42-8 - Names and Identifiers
| Name | (4-chloro-3-fluoro-phenyl)-iodo-zinc |
| Synonyms | 4-CHLORO-3-FLUOROPHENYLZINC IODIDE (4-chloro-3-fluoro-phenyl)-iodo-zinc 4-chloro-3-fluorophenylzinc iodide solution 4-CHLORO-3-FLUOROPHENYLZINC IODIDE, 0.5M SOLUTION IN TETRAHYDROFURAN |
| CAS | 312693-42-8 |
| InChI | InChI=1/C6H3ClF.HI.Zn/c7-5-3-1-2-4-6(5)8;;/h1,3-4H;1H;/q;;+1/p-1/rC6H3ClFIZn/c7-5-2-1-4(10-9)3-6(5)8/h1-3H |
312693-42-8 - Physico-chemical Properties
| Molecular Formula | C6H3ClFIZn |
| Molar Mass | 321.83 |
| Density | 1.024g/mLat 25°C |
| Boling Point | 65°C |
| Flash Point | 1°F |
312693-42-8 - Risk and Safety
| Risk Codes | R14 - Reacts violently with water R19 - May form explosive peroxides R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. R40 - Limited evidence of a carcinogenic effect R36/37 - Irritating to eyes and respiratory system. R11 - Highly Flammable |
| Safety Description | S16 - Keep away from sources of ignition. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S33 - Take precautionary measures against static discharges. S36 - Wear suitable protective clothing. S36/37 - Wear suitable protective clothing and gloves. |
| UN IDs | UN 2056 3/PG 2 |
| WGK Germany | 1 |
312693-42-8 - Introduction
(4-choro-3-fluoro-phenyl)-iodo-zinc is an organic compound with the chemical formula C6H4ClFIZn. Its properties are as follows:
1. Appearance:(4-chloro-3-fluoro-phenyl)-iodo-zinc are white crystals or powdery solids.
2. Storage conditions: it should be stored in a dry, cool place, away from fire and oxidant.
3. Solubility:(4-chloro-3-fluoro-phenyl)-iodo-zinc has good solubility in common organic solvents (such as ethanol, chloroform, dimethylformamide, etc.).
4. Stability: It is a stable compound, but it has a certain degree of oxidation in the air.
(4-choro-3-fluoro-phenyl)-iodo-zinc are used as follows:
1. Organic synthesis: It is often used as a reagent for organic synthesis, especially for the substitution reaction of aromatic compounds.
2. Materials Science:(4-chloro-3-fluoro-phenyl)-iodo-zinc can be used in the preparation of functional materials, such as organic optoelectronic materials and organic semiconductor materials.
3. Drug research: it is also applied in the field of drug research, and can be used as a substitution group or nuclear group in drug molecules.
Regarding the production method,(4-chloro-3-fluoro-phenyl)-iodo-zinc is usually obtained by reacting 4-chloro-3-fluorophenyl bromide with zinc powder in the presence of zinc iodide (ZnI2). The specific chemical reaction conditions need to be adjusted according to the actual situation.
Safety information, (4-choro-3-fluoro-phenyl)-iodo-zinc is a chemical, should pay attention to the following:
1. Avoid contact with skin and eyes, if contact, should immediately rinse with plenty of water.
2. Avoid inhaling the dust or gas of the compound to prevent respiratory irritation and poisoning.
3. During use or storage, avoid direct contact with combustibles, oxidants and other substances to prevent fire or explosion.
4. Please handle and dispose of the compound and its waste in the correct way to avoid pollution to the environment.
1. Appearance:(4-chloro-3-fluoro-phenyl)-iodo-zinc are white crystals or powdery solids.
2. Storage conditions: it should be stored in a dry, cool place, away from fire and oxidant.
3. Solubility:(4-chloro-3-fluoro-phenyl)-iodo-zinc has good solubility in common organic solvents (such as ethanol, chloroform, dimethylformamide, etc.).
4. Stability: It is a stable compound, but it has a certain degree of oxidation in the air.
(4-choro-3-fluoro-phenyl)-iodo-zinc are used as follows:
1. Organic synthesis: It is often used as a reagent for organic synthesis, especially for the substitution reaction of aromatic compounds.
2. Materials Science:(4-chloro-3-fluoro-phenyl)-iodo-zinc can be used in the preparation of functional materials, such as organic optoelectronic materials and organic semiconductor materials.
3. Drug research: it is also applied in the field of drug research, and can be used as a substitution group or nuclear group in drug molecules.
Regarding the production method,(4-chloro-3-fluoro-phenyl)-iodo-zinc is usually obtained by reacting 4-chloro-3-fluorophenyl bromide with zinc powder in the presence of zinc iodide (ZnI2). The specific chemical reaction conditions need to be adjusted according to the actual situation.
Safety information, (4-choro-3-fluoro-phenyl)-iodo-zinc is a chemical, should pay attention to the following:
1. Avoid contact with skin and eyes, if contact, should immediately rinse with plenty of water.
2. Avoid inhaling the dust or gas of the compound to prevent respiratory irritation and poisoning.
3. During use or storage, avoid direct contact with combustibles, oxidants and other substances to prevent fire or explosion.
4. Please handle and dispose of the compound and its waste in the correct way to avoid pollution to the environment.
Last Update：2024-04-09 21:49:45
