31329-64-3 - Names and Identifiers
Name | 3,5-Dimethyl-4-isoxazolamine
|
Synonyms | AKOS B020738 ART-CHEM-BB B020738 TIMTEC-BB SBB005896 3,5-DIMETHYL-4-ISOXAZOLAMINE 3,5-Dimethyl-4-isoxazolamine 3,5-dimethylisoxazol-4-amine 4-AMINO-3,5-DIMETHYLISOXAZOLE 3,5-Dimethylisoxazole-4-amine 3,5-dimethyl-1,2-oxazol-4-amine 3,5-DIMETHYL-ISOXAZOL-4-YLAMINE
|
CAS | 31329-64-3
|
InChI | InChI=1/C5H8N2O/c1-3-5(6)4(2)8-7-3/h6H2,1-2H3 |
31329-64-3 - Physico-chemical Properties
Molecular Formula | C5H8N2O
|
Molar Mass | 112.13 |
Density | 1.118±0.06 g/cm3(Predicted) |
Melting Point | 41-46°C(lit.) |
Boling Point | 78-80°C 0,4mm |
Flash Point | 95°C |
Vapor Presure | 0.056mmHg at 25°C |
pKa | 1.59±0.10(Predicted) |
Storage Condition | -20°C |
Refractive Index | 1.52 |
31329-64-3 - Risk and Safety
Hazard Symbols | Xi - Irritant
|
Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin.
|
Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
S36 - Wear suitable protective clothing.
S37/39 - Wear suitable gloves and eye/face protection
|
WGK Germany | 3 |
31329-64-3 - Introduction
3,5-dimethyl-4-isoxazolamine (3,5-dimethyl-4-isoxazolamine) is an organic compound with the following properties:
1. Appearance: 3,5-dimethyl-4-isoxazolamine is a colorless to pale yellow solid.
2. Solubility: It has high solubility in water and certain solubility in regular organic solvents.
3. Chemical properties: 3,5-dimethyl-4-isoxazolamine is electrophilic and can be used as an amination reagent to carry out amine substitution reactions with acids, aldehydes, ketones, etc.
4. Use: in the field of organic synthesis, 3,5-dimethy1-4-isoxazolamine is commonly used in the synthesis of other organic compounds, such as drugs, pesticides, dyes, etc. It can be used as an intermediate to participate in a series of organic synthesis reactions.
5. Preparation method: 3,5-dimethy1-4-isoxazolamine can usually be prepared by the chemical reaction of isoxazole compounds. There are many specific synthetic methods, and the commonly used methods include Amination of isoxazole, cyclization of isoxazole, etc.
6. Safety Information: there is no clear data on the specific toxicity and harmfulness of 3,5-dimethyl-4-isoxazolamine. However, as a chemical substance, care should be taken to follow correct laboratory safety procedures, including wearing personal protective equipment, avoiding direct contact with skin and eyes, and preventing inhalation or ingestion. When using and handling, should follow the relevant safety instructions. For specific safety information, it is recommended to refer to the safety data form provided by the chemical supplier.
Last Update:2024-04-09 15:17:56