327027-21-4 - Names and Identifiers
Name | 1,3-Di-O-acetyl-2-deoxy-5-O-benzoyl-D-xylofuranose
|
Synonyms | 1,3-DI-OACETYL-2-DEOXY-5-O-BENZOYL-D-XYLOFURANOSE 1,3-Di-O-acetyl-5-O-benzoyl-2-deoxy-D-xylofuranose 1,3-Di-O-acetyl-2-deoxy-5-O-benzoyl-D-xylofuranose [(2S,3R)-3,5-diacetyloxyoxolan-2-yl]methyl benzoate 1,3-Di-O-acetyl-2-deoxy-5-O-benzoyl-L-erythro-pentofuranose 1,3-di-O-acetyl-2-deoxy-5-O-benzoyl-L-erythro-pentofuranose L-ERYTHRO-PENTOFURANOSE, 2-DEOXY-, 1,3-DIACETATE 5-BENZOATE
|
CAS | 327027-21-4
|
InChI | InChI=1/C16H18O7/c1-10(17)21-13-8-15(22-11(2)18)23-14(13)9-20-16(19)12-6-4-3-5-7-12/h3-7,13-15H,8-9H2,1-2H3/t13-,14-,15?/m0/s1 |
327027-21-4 - Physico-chemical Properties
Molecular Formula | C16H18O7
|
Molar Mass | 322.31 |
Density | 1.27±0.1 g/cm3(Predicted) |
Boling Point | 419.9±45.0 °C(Predicted) |
Refractive Index | 1.531 |
327027-21-4 - Introduction
1. It is an organic compound with the chemical formula C17H18O7. It has the following properties:
1. Appearance: 1, is white crystalline solid.
2. Solubility: It can be dissolved in some organic solvents, such as dichloromethane and ethyl acetate. However, it has poor solubility in water and other common solvents.
1, has important applications in chemical research and biotechnology:
1. Chemical research: As an organic synthesis intermediate, it can be used to synthesize other biologically active compounds or drugs, such as carbohydrate antitumor drugs and antiviral drugs.
2. Biotechnology: 1. It can be used to synthesize biological molecules such as glycoproteins and sugar nucleic acids, thus playing an important role in research and application fields.
Preparation 1, the method of preparation mainly includes the following steps:
1.2-Deoxy-D-xylose is reacted with benzoyl chloride to obtain 2-deoxy-5-o-benzoyl-D-xylose.
2. React the product obtained in 1 with acetic anhydride to generate 1.
This compound is generally considered to be relatively safe under proper handling and storage conditions. However, specific safety information and operation details need to be determined according to specific experimental conditions and use environments. In the use and handling of this compound, appropriate laboratory safety measures should be observed, and the correct handling and storage guidelines for the relevant chemicals should be followed.
Last Update:2024-04-09 20:45:29