33234-36-5

33234-36-5 - Names and Identifiers

Name	2-chloro-3-methoxybenzoic acid
Synonyms	oro-3-methoxybenzoic acid 2-chloro-3-methoxybenzoic acid BENZOICACID,2-CHLORO-3-METHOXY 2-CHLORO-3-METHOXYBENZOIC ACID 97
CAS	33234-36-5
InChI	InChI=1/C8H7ClO3/c1-12-6-4-2-3-5(7(6)9)8(10)11/h2-4H,1H3,(H,10,11)

33234-36-5 - Physico-chemical Properties

Molecular Formula	C8H7ClO3
Molar Mass	186.59
Density	1.352±0.06 g/cm3(Predicted)
Melting Point	161-165 °C
Boling Point	315.0±22.0 °C(Predicted)
Flash Point	144.3°C
Vapor Presure	0.00019mmHg at 25°C
pKa	2.84±0.25(Predicted)
Storage Condition	Sealed in dry,Room Temperature
Refractive Index	1.562

33234-36-5 - Risk and Safety

Hazard Symbols	Xn - Harmful
Risk Codes	22 - Harmful if swallowed
UN IDs	UN 2811 6.1/PG 3
WGK Germany	3

33234-36-5 - Introduction

acid is an organic compound with the chemical formula C8H7ClO3. Its nature is as follows:

1. Appearance and properties: acid is a white crystalline solid.
2. Solubility: low solubility in water, more easily dissolved in organic solvents such as ethanol, ether and chloroform.
3. Melting Point: about 167-170 ℃.
4. Acidity: can release a proton (H ), showing the nature of acid.

The main purpose of acid:

1. Chemical synthesis: It can be used as an intermediate in organic synthesis and used to prepare other compounds.
2. Pesticide research: Because it has certain bactericidal and insecticidal effects, it is widely used in pesticide research and development.

method of preparing the wet acid:

can be prepared by reacting 2-methoxybenzoic acid with Chloroacetyl Chloride. The reaction conditions may be carried out in the presence of sodium acetate at room temperature.

Regarding safety information, you need to pay attention to the following points:

1. Toxicity: acid has a certain irritation and toxicity, should avoid inhalation and skin contact.
2. Keep away from light: Because of its certain photosensitivity, it should be stored in a place away from light.
3. Operation attention: when handling and using the compound, take appropriate personal protective measures, such as wearing gloves, protective glasses and protective mask.
4. Storage Note: It should be stored in a dry, well-ventilated place, away from fire and oxidant.

Last Update：2024-04-10 22:29:15