33354-75-5

33354-75-5 - Names and Identifiers

Name	4,4',4''-trimethyl-2,2':6',2''-terpyridine
Synonyms	33354-75-5 2,6-Bis(4-methyl-2-pyridyl)-4-methylpyridine
CAS	33354-75-5
InChI	InChI=1/C18H17N3/c1-12-4-6-19-15(8-12)17-10-14(3)11-18(21-17)16-9-13(2)5-7-20-16/h4-11H,1-3H3

33354-75-5 - Physico-chemical Properties

Molecular Formula	C18H17N3
Molar Mass	275.35
Density	1.108±0.06 g/cm3(Predicted)
Boling Point	422.5±40.0 °C(Predicted)
Flash Point	183.9°C
Vapor Presure	5.91E-07mmHg at 25°C
Appearance	Powder
Color	white to off-white
pKa	5.51±0.42(Predicted)
Storage Condition	2-8 ℃, dark, nitrogen storage
Refractive Index	1.592

33354-75-5 - Introduction

4,4 ',4 "-trimethyl-2,2':6 ',2"-terpyridine is an organic compound with the chemical formula C19H21N3 and a molecular weight of 303.4g/mol. It is a yellow solid with good solubility.

Nature:
4,4 ',4 ''-trimethyl-2,2':6 ',2''-terpyridine has the following properties:
1. Melting Point: 160-164 ℃
2. Heat of fusion: 9-12 kilojoules/mole
3. Insoluble in water, but soluble in organic solvents such as ethanol, dimethylformamide
4. Has strong fluorescence properties

Use:
4,4 ',4 ''-trimethyl-2,2':6 ',2''-terpyridine has a wide range of applications in the chemical field, mainly including the following aspects:
1. As a ligand for the preparation of coordination compounds, can form stable metal complexes, such as platinum, iridium, copper plasma coordination compounds.
2. Used as the synthesis of organic optoelectronic materials, can be used to prepare light-emitting diodes (LED), organic chemiluminescent materials, etc.
3. Used as a catalyst in organic synthesis, participate in the reaction of metal organic compounds, with cyclization, hydrogenation, exchange reaction catalytic ability.

Method:
4,4 ',4 ''-trimethyl-2,2':6 ',2''-terpyridine has two main synthetic methods, namely:
1. Using lutidine and diethyl ether as raw materials, the product was obtained by platinum-catalyzed reaction.
2. Using catechuic acid and pyridine anhydride through condensation reaction synthesis.

Safety Information:
For the safety of 4,4 ',4 ''-trimethyl-2,2':6 ',2''-terpyridine, there is currently no clear toxicity data, but general laboratory operation measures should be taken, if wearing protective gloves and glasses, avoid inhalation and contact with skin. If ingested by mistake or in contact with skin, wash immediately and seek medical help. When stored, it should be kept in a dry, well-ventilated place, away from fire and oxidizing agents.

Last Update：2024-04-10 22:39:43