Name | D-panose |
Synonyms | PANOSE D-panose D-PANOSE panose mixed anomers 4-?Isomaltosylglucose 4-ALPHA-ISOMALTOSYLGLUCOSE |
CAS | 33401-87-5 |
EINECS | 251-500-2 |
InChI | InChI=1/C18H32O16/c19-1-4-7(21)9(23)13(27)17(32-4)30-3-6-8(22)10(24)14(28)18(33-6)34-15-5(2-20)31-16(29)12(26)11(15)25/h4-29H,1-3H2/t4-,5-,6-,7-,8-,9+,10+,11-,12-,13-,14-,15-,16+,17+,18-/m1/s1 |
Molecular Formula | C18H32O16 |
Molar Mass | 504.44 |
Density | 1.75±0.1 g/cm3(Predicted) |
Melting Point | 223 °C |
Boling Point | 960.0±65.0 °C(Predicted) |
Flash Point | 474.4°C |
Solubility | Dissolve (43g/L) (25°C), |
Vapor Presure | 1.53E-34mmHg at 25°C |
Appearance | White powder |
BRN | 100481 |
pKa | 12.39±0.20(Predicted) |
Storage Condition | 2-8℃ |
Sensitive | Air and light sensitivity |
Refractive Index | 155 ° (C=2, H2O) |
MDL | MFCD00151376 |
WGK Germany | 3 |
FLUKA BRAND F CODES | 3 |
HS Code | 29400090 |
Reference Show more | 1. Wang, Junying, et al. "Biochemical characterization and molecular mechanism of acid denaturation of a novel α-amylase from Aspergillus niger." Biochemical Engineering Journal 137 (2018): 222-231.https://doi.org/10.1016/j.bej.2018.06.004 |
use | D-panose has been used to study and determine the composition and sequence of carbon -13 nuclear magnetic resonance dextran containing mixed correlation. It is also used to study the electrophoretic behavior of sugar isomers. |