339279-00-4

339279-00-4 - Names and Identifiers

Name	4-chloro-6-(MethoxyMethyl)-2-(3-pyridinyl)-Pyrimidine
Synonyms	4-CHLORO-6-(METHOXYMETHYL)-2-(3-PYRIDYL)PYRIMIDINE 4-chloro-6-(MethoxyMethyl)-2-(3-pyridinyl)-Pyrimidine pyrimidine, 4-chloro-6-(methoxymethyl)-2-(3-pyridinyl)- PyriMidine, 4-chloro-6-(MethoxyMethyl)-2-(3-pyridinyl)-
CAS	339279-00-4
InChI	InChI=1S/C11H10ClN3O/c1-16-7-9-5-10(12)15-11(14-9)8-3-2-4-13-6-8/h2-6H,7H2,1H3

339279-00-4 - Physico-chemical Properties

Molecular Formula	C11H10ClN3O
Molar Mass	235.67
Density	1.270
Boling Point	276℃
Flash Point	121℃
pKa	2.55±0.12(Predicted)
Storage Condition	2-8°C

339279-00-4 - Introduction

4-choro-6-(MethoxyMethyl)-2-(3-pyridinyl)-Pyrimidine is an organic compound. Its chemical formula is C12H11ClN3O.

Some of the properties of this compound include:
-Appearance: White solid
-melting point: 84-86 ℃
-Boiling point: 376.7 ℃
-Density: 1.40g/cm³
-Solubility: Soluble in organic solvents such as ethanol and dimethyl sulfoxide

4-chloro-6-(MethoxyMethyl)-2-(3-pyridinyl)-Pyrimidine have certain uses in the field of medicine. It is an intermediate commonly used to inhibit antipyretic and analgesic drugs and can be used to synthesize non-steroidal anti-inflammatory drugs (such as NSAIDs) and other drugs.

Methods for preparing 4-chloro-6-(MethoxyMethyl)-2-(3-pyridinyl)-Pyrimidine generally involve functional changes to pyrimidines. It can usually be synthesized by the following steps:
1. reacting pyridine with sodium cyanate to generate pyridine-3-carboxylic acid;
2. carbamoylation of pyridine-3-carboxylic acid to obtain 3-methoxymethylpyridine;
3. Under alkaline conditions, 3-methoxy methyl pyridine and bromoacetyl were subjected to SN2 substitution reaction to obtain methyl 2-(3-pyridyl) acetate;
4. Finally, methyl 2-(3-pyridyl) acetate is reacted with stannous chloride to give 4-chloro-6-(MethoxyMethyl)-2-(3-pyridinyl)-Pyrimidine.

Regarding safety information, specific toxicity data for 4-chloro-6-(MethoxyMethyl)-2-(3-pyridinyl)-Pyrimidine is not currently available, so it is necessary to pay attention to relevant safety procedures when using or handling, such as wearing gloves, goggles and protective clothing. Depending on the nature of the similar compound, it may have a certain degree of irritation and allergenicity. A suitable ventilation system should be used during use or handling to avoid inhalation or skin contact. At the same time, store it in a dry, cool place, away from fire and oxidizing agents. If you have any discomfort or questions, you should immediately seek medical attention and consult relevant professionals.

Last Update：2024-04-09 21:11:58