3621-81-6
2,5-Dichlorobenzooxazole
CAS: 3621-81-6
Molecular Formula: C7H3Cl2NO
3621-81-6 - Names and Identifiers
| Name | 2,5-Dichlorobenzooxazole |
| Synonyms | 2,5-DICHLOROBENZOXAZOLE 2,5-Dichlorobenzooxazole Benzoxazole, 2,5-dichloro- 2,5-dichlorobenzo[d]oxazole 2,5-Dichloro-1,3-benzoxazole 2,5-Dichlorobenzooxazole (For suvorexant) Benzoxazole, 2,5-dichloro- (6CI,7CI,8CI,9CI) |
| CAS | 3621-81-6 |
| InChI | InChI=1/C7H3Cl2NO/c8-4-1-2-6-5(3-4)10-7(9)11-6/h1-3H |
3621-81-6 - Physico-chemical Properties
| Molecular Formula | C7H3Cl2NO |
| Molar Mass | 188.01 |
| Density | 1.522±0.06 g/cm3(Predicted) |
| Melting Point | 44-46 °C |
| Boling Point | 130-133 °C(Press: 25 Torr) |
| Flash Point | 100.683°C |
| Vapor Presure | 0.052mmHg at 25°C |
| pKa | -1.40±0.10(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Refractive Index | 1.636 |
3621-81-6 - Risk and Safety
| Hazard Class | IRRITANT |
3621-81-6 - Introduction
2,5-Dichlorobenzooxazole(2,5-Dichlorobenzooxazole) is an organic compound with some of the following properties:
1. Appearance: White crystalline solid.
2. molecular formula: C7H3Cl2NO.
3. molecular weight: 188.01.
4. Melting point: 108-111 degrees Celsius.
5. boiling point: 233 degrees Celsius (decomposition).
2,5-Dichlorobenzooxazole has a wide range of applications:
1. Pesticide: It is widely used in the manufacture of pesticides and fungicides to fight various farmland pests and pathogenic microorganisms.
2. Medicine: It can also be used as an intermediate compound for the synthesis of various drugs and bioactive molecules.
3. Chemical research: 2,5-Dichlorobenzooxazole can also be used in organic synthesis reactions and chemical research.
The common method for preparing 2,5-Dichlorobenzooxazole is through the synthesis of dichlorobenzene carboxylic acid derivatives and ammonia. A particular synthetic route may involve multiple steps in which some organic reagents and catalysts may be used.
For safety information, please note the following:
1. 2,5-Dichlorobenzooxazole is an organic compound and should be handled with care. Appropriate protective equipment, such as gloves, goggles and protective clothing, is required during operation.
2. 2,5-Dichlorobenzooxazole may have certain health hazards. Exposure to or inhalation of its dust or vapors may cause eye and skin irritation and even respiratory and digestive tract discomfort.
3. When handling or storing 2,5-Dichlorobenzooxazole, please avoid contact with oxidants and strong acids to prevent dangerous chemical reactions.
4. In addition, the laboratory or working environment where the compound is used should take appropriate exhaust and safety measures to ensure the safety of personnel.
In general, 2,5-Dichlorobenzooxazole is a widely used organic compound, but it should be used in accordance with relevant safety procedures.
1. Appearance: White crystalline solid.
2. molecular formula: C7H3Cl2NO.
3. molecular weight: 188.01.
4. Melting point: 108-111 degrees Celsius.
5. boiling point: 233 degrees Celsius (decomposition).
2,5-Dichlorobenzooxazole has a wide range of applications:
1. Pesticide: It is widely used in the manufacture of pesticides and fungicides to fight various farmland pests and pathogenic microorganisms.
2. Medicine: It can also be used as an intermediate compound for the synthesis of various drugs and bioactive molecules.
3. Chemical research: 2,5-Dichlorobenzooxazole can also be used in organic synthesis reactions and chemical research.
The common method for preparing 2,5-Dichlorobenzooxazole is through the synthesis of dichlorobenzene carboxylic acid derivatives and ammonia. A particular synthetic route may involve multiple steps in which some organic reagents and catalysts may be used.
For safety information, please note the following:
1. 2,5-Dichlorobenzooxazole is an organic compound and should be handled with care. Appropriate protective equipment, such as gloves, goggles and protective clothing, is required during operation.
2. 2,5-Dichlorobenzooxazole may have certain health hazards. Exposure to or inhalation of its dust or vapors may cause eye and skin irritation and even respiratory and digestive tract discomfort.
3. When handling or storing 2,5-Dichlorobenzooxazole, please avoid contact with oxidants and strong acids to prevent dangerous chemical reactions.
4. In addition, the laboratory or working environment where the compound is used should take appropriate exhaust and safety measures to ensure the safety of personnel.
In general, 2,5-Dichlorobenzooxazole is a widely used organic compound, but it should be used in accordance with relevant safety procedures.
Last Update：2024-04-09 18:58:34
