37131-89-8
2,4-Dichloropyrimidine-5-carboxylic acid
CAS: 37131-89-8
Molecular Formula: C5H2Cl2N2O2
37131-89-8 - Names and Identifiers
| Name | 2,4-Dichloropyrimidine-5-carboxylic acid |
| Synonyms | Pyrazino[2,3-f][1,12]phenanthroline 2,4-Dichloropyrimidine-5-carboxylic acid 2,4-Dichloro-5-pyrimidinecarboxylic acid 5-PyriMidinecarboxylic acid, 2,4-dichloro- |
| CAS | 37131-89-8 |
| InChI | InChI=1/C5H2Cl2N2O2/c6-3-2(4(10)11)1-8-5(7)9-3/h1H,(H,10,11) |
37131-89-8 - Physico-chemical Properties
| Molecular Formula | C5H2Cl2N2O2 |
| Molar Mass | 192.99 |
| Density | 1.718 |
| Melting Point | 90-97 °C |
| Boling Point | 368.4±22.0 °C(Predicted) |
| Flash Point | 176.592°C |
| Vapor Presure | 0mmHg at 25°C |
| pKa | 0.97±0.32(Predicted) |
| Storage Condition | Inert atmosphere,Store in freezer, under -20°C |
| Refractive Index | 1.614 |
37131-89-8 - Risk and Safety
| Hazard Symbols | Xn - Harmful |
| Risk Codes | 22 - Harmful if swallowed |
| WGK Germany | 3 |
| Hazard Class | IRRITANT-HARMFUL |
