384346-27-4
3-(4-Chlorophenoxy)piperidine
CAS: 384346-27-4
Molecular Formula: C11H14ClNO
384346-27-4 - Names and Identifiers
| Name | 3-(4-Chlorophenoxy)piperidine |
| Synonyms | 3-(4-Chlorophenoxy)piperidine 3-(4-Chlorophenoxy)piperidine Piperidine, 3-(4-chlorophenoxy)- piperidine, 3-(4-chlorophenoxy)- |
| CAS | 384346-27-4 |
| InChI | InChI=1/C11H14ClNO/c12-9-3-5-10(6-4-9)14-11-2-1-7-13-8-11/h3-6,11,13H,1-2,7-8H2 |
384346-27-4 - Physico-chemical Properties
| Molecular Formula | C11H14ClNO |
| Molar Mass | 211.69 |
| Density | 1.150±0.06 g/cm3(Predicted) |
| Boling Point | 312.8±32.0 °C(Predicted) |
| Flash Point | 142.9°C |
| Water Solubility | Soluble in water. |
| Vapor Presure | 0.000519mmHg at 25°C |
| pKa | 9.08±0.10(Predicted) |
| Refractive Index | 1.538 |
384346-27-4 - Introduction
3-(4-Chlorophenoxy)piperidine is an organic compound with the formula C11H14ClNO. The following is a brief description of its nature, use, preparation and safety information:
Nature:
1. Appearance: colorless liquid or crystalline solid.
2. Melting point: about 43-45°C.
3. Boiling point: about 140-144°C.
4. Solubility: Soluble in common organic solvents such as dimethylformamide (DMF), dichloromethane, etc.
Use:
1. 3-(4-Chlorophenoxy)piperidine are widely used in the field of organic synthesis.
2. It can be used as an intermediate or raw material for the synthesis of biologically active molecules, and can be used for the preparation of a variety of drugs, pesticides and other biologically active molecules.
Preparation Method:
The preparation of 3-(4-Chlorophenoxy)piperidine is generally carried out by chemical reaction. A common synthetic method is the reaction of 4-chlorophenol with piperidine under basic conditions to yield the desired product.
Safety Information:
1. The toxicity of 3-(4-Chlorophenoxy)piperidine is low, but it should be used with caution.
2. contact with skin or eyes may cause irritation, should avoid prolonged contact.
3. Appropriate safety measures should be taken during use, such as wearing appropriate protective gloves, masks and goggles.
4. should be stored in a cool, dry place, away from fire and flammable materials.
Nature:
1. Appearance: colorless liquid or crystalline solid.
2. Melting point: about 43-45°C.
3. Boiling point: about 140-144°C.
4. Solubility: Soluble in common organic solvents such as dimethylformamide (DMF), dichloromethane, etc.
Use:
1. 3-(4-Chlorophenoxy)piperidine are widely used in the field of organic synthesis.
2. It can be used as an intermediate or raw material for the synthesis of biologically active molecules, and can be used for the preparation of a variety of drugs, pesticides and other biologically active molecules.
Preparation Method:
The preparation of 3-(4-Chlorophenoxy)piperidine is generally carried out by chemical reaction. A common synthetic method is the reaction of 4-chlorophenol with piperidine under basic conditions to yield the desired product.
Safety Information:
1. The toxicity of 3-(4-Chlorophenoxy)piperidine is low, but it should be used with caution.
2. contact with skin or eyes may cause irritation, should avoid prolonged contact.
3. Appropriate safety measures should be taken during use, such as wearing appropriate protective gloves, masks and goggles.
4. should be stored in a cool, dry place, away from fire and flammable materials.
Last Update：2024-04-09 02:00:45
