3962-66-1
oestr-5(10)-ene-3,17-dione
CAS: 3962-66-1
Molecular Formula: C18H24O2
3962-66-1 - Names and Identifiers
| Name | oestr-5(10)-ene-3,17-dione |
| Synonyms | ESTRA-5-ENE-3,17-DIONE ESTR-5(10)-ENE-3,17-DIONE oestr-5(10)-ene-3,17-dione Estra-5(10)-ene-3,17-dione ESTR-5(10)-EN-17SS-OL-3-ONE Estr-5-ene-3beta,17beta-dione 19-NOR-Androst-5(10)-ene-3,17- (8R,9S,13S,14S)-13-methyl-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione |
| CAS | 3962-66-1 |
| EINECS | 223-564-1 |
| InChI | InChI=1/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h14-16H,2-10H2,1H3/t14-,15-,16+,18+/m1/s1 |
3962-66-1 - Physico-chemical Properties
| Molecular Formula | C18H24O2 |
| Molar Mass | 272.38 |
| Density | 1.13±0.1 g/cm3(Predicted) |
| Melting Point | 144-146 °C |
| Boling Point | 427.5±45.0 °C(Predicted) |
| Flash Point | 159.7°C |
| Water Solubility | 24mg/L at 20℃ |
| Vapor Presure | 0.001Pa at 25℃ |
| Refractive Index | 1.555 |
| Physical and Chemical Properties | Chemical properties crystallization. Melting point 145-146 ℃. [α]24/D 270 ° (chloroform), [α]D 265 °(C 1.00, dioxane). |
| Use | For drug synthesis |
3962-66-1 - Upstream Downstream Industry
| Downstream Products | 3,3-DIMETHOXYESTR-5(10)-ENE-17 B OL |
Supplier List
View History
Downstream Products for 3962-66-1