4,6-diMethylpyridin-3-aMine

4,6-diMethylpyridin-3-aMine - Names and Identifiers

Name	5-Amino-2,4-dimethylpyridine
Synonyms	IFLAB-BB F1957-0017 4,6-diMethylpyridin-3-aMine 4,6-Dimethylpyridin-3-amine 3-AMINO-4,6-DIMETHYLPYRIDINE 5-Amino-2,4-dimethylpyridine 3-Amino-4,6-dimethylpyridine 5-AMINO-2,4-DIMETHYLPYRIDINE 3-pyridinamine, 4,6-dimethyl- 3-PyridinaMine, 4,6-diMethyl- 4,6-Dimethylpyridin-3-amine, 5-Amino-2,4-lutidine 5-Methyl-1H-pyrrole-3-carboxylic acid ethyl ester
CAS	1193-71-1
InChI	InChI=1/C7H10N2/c1-5-3-6(2)9-4-7(5)8/h3-4H,8H2,1-2H3

4,6-diMethylpyridin-3-aMine - Physico-chemical Properties

Molecular Formula	C7H10N2
Molar Mass	122.17
Density	1.039±0.06 g/cm3(Predicted)
Melting Point	68 °C
Boling Point	255-257 °C
Flash Point	133.1°C
Vapor Presure	0.0148mmHg at 25°C
pKa	7.54±0.18(Predicted)
Storage Condition	under inert gas (nitrogen or Argon) at 2–8 °C
Refractive Index	1.564

4,6-diMethylpyridin-3-aMine - Risk and Safety

Hazard Symbols	Xi - Irritant
Hazard Note	Irritant

4,6-diMethylpyridin-3-aMine - Introduction

2,4-Dimethyl-5-aminopyridine (2,4-Dimethyl-5-aminopyridine) is an organic compound with the following properties:

1. Appearance: 2,4-dimethyl-5-aminopyridine is a colorless to pale yellow crystal or crystalline powder.
2. Solubility: It can be dissolved in many organic solvents, such as ethanol, dimethylformamide and ether, with high solubility.
3. Melting point: Its melting point range is 78-82°C.
4. chemical properties: 2,4-dimethyl -5-amino pyridine is a basic compound, can react with acid to generate salt, and can catalyze some organic reactions.

The main uses of 2,4-dimethyl-5-aminopyridine include:

1. Catalyst: It is often used as a catalyst in organic synthesis, especially in esterification, acylation and oxidation reactions.
2. Drug synthesis: It can be used as an intermediate or catalyst in drug synthesis, such as the preparation of active components of certain drugs.
3. Surfactant: It can be used as a component of certain surfactants, such as applications in polyurethane coatings, polyamide resins, etc.

The preparation method of 2,4-dimethyl-5-aminopyridine can be carried out by the following steps:

1. pyridine is introduced into the dimethylamino group through a series of chemical reactions.
2. Further oxidation reaction to convert dimethyl-5-aminopyridine into 2,4-dimethyl-5-aminopyridine.

Regarding safety information, 2,4-dimethyl-5-aminopyridine is a chemical, and the following safety precautions should be noted:

1. avoid contact with skin and eyes: contact should immediately rinse the affected area with plenty of water.
2. Avoid inhalation and intake: Avoid inhaling dust and solution during operation, and avoid eating by mistake.
3. proper ventilation: in the operation should ensure good ventilation, avoid the accumulation of harmful gases.
4. storage safety: should be stored in a dry, cool, ventilated place, away from fire and oxidant.
5. special warning: specific should refer to the safety data sheet and the relevant safety operation guide.

Last Update：2024-04-09 20:02:46