4,6-dichloro-2-oxo-2H-chromene-3-carbaldehyde
4,6-dichloro-2-oxo-2H-chromene-3-carbaldehyde
CAS: 51069-87-5
Molecular Formula: C10H4Cl2O3
4,6-dichloro-2-oxo-2H-chromene-3-carbaldehyde - Names and Identifiers
| Name | 4,6-dichloro-2-oxo-2H-chromene-3-carbaldehyde |
| Synonyms | 4 6-DICHLORO-3-FORMYLCOUMARIN 97 4,6-dichloro-2-oxo-2H-chromene-3-carbaldehyde 2H-1-Benzopyran-3-carboxaldehyde, 4,6-dichloro-2-oxo- |
| CAS | 51069-87-5 |
| InChI | InChI=1/C10H4Cl2O3/c11-5-1-2-8-6(3-5)9(12)7(4-13)10(14)15-8/h1-4H |
4,6-dichloro-2-oxo-2H-chromene-3-carbaldehyde - Physico-chemical Properties
| Molecular Formula | C10H4Cl2O3 |
| Molar Mass | 243.04 |
| Density | 1.58g/cm3 |
| Melting Point | 147-151°C(lit.) |
| Boling Point | 412.3°C at 760 mmHg |
| Flash Point | 188.6°C |
| Vapor Presure | 5.25E-07mmHg at 25°C |
| Refractive Index | 1.631 |
4,6-dichloro-2-oxo-2H-chromene-3-carbaldehyde - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
4,6-dichloro-2-oxo-2H-chromene-3-carbaldehyde - Introduction
4, is an organic compound with the chemical formula C11H5Cl2O3. The following is a description of its nature, use, preparation and safety information:
1. nature:
-Appearance: 4, white to light yellow solid.
-Solubility: It has good solubility in organic solvents, such as methanol, ethanol and dichloromethane.
-Melting point: Its melting point is about 210-212°C.
-Stability: Stable at room temperature, but decomposition may occur when encountering heat, light, air and strong oxidants.
2. use:
-Chemical synthesis: 4. It can be used in organic synthesis reactions and participate in various chemical reactions such as Grignard reaction, oxidation reaction and activation reaction.
-Fungicide: It can also be used as a fungicide in agriculture and horticulture to prevent and control plant diseases.
3. Preparation method:
4. The preparation method of the compound is more complicated. One commonly used method is to obtain it through the chlorination reaction of hydroxycoumarin derivatives. The specific preparation method can refer to the relevant organic synthesis literature.
4. Safety Information:
- 4, may cause irritation to eyes, skin and breathing, should avoid contact.
-Be careful to prevent swallowing, inhalation and contact during use and storage.
-Wear protective glasses, protective gloves and appropriate protective clothing during operation.
-In case of accidental inhalation or contact, wash plenty of water immediately and seek medical help.
-Waste shall be disposed of in accordance with local environmental regulations and shall not be discharged at will.
1. nature:
-Appearance: 4, white to light yellow solid.
-Solubility: It has good solubility in organic solvents, such as methanol, ethanol and dichloromethane.
-Melting point: Its melting point is about 210-212°C.
-Stability: Stable at room temperature, but decomposition may occur when encountering heat, light, air and strong oxidants.
2. use:
-Chemical synthesis: 4. It can be used in organic synthesis reactions and participate in various chemical reactions such as Grignard reaction, oxidation reaction and activation reaction.
-Fungicide: It can also be used as a fungicide in agriculture and horticulture to prevent and control plant diseases.
3. Preparation method:
4. The preparation method of the compound is more complicated. One commonly used method is to obtain it through the chlorination reaction of hydroxycoumarin derivatives. The specific preparation method can refer to the relevant organic synthesis literature.
4. Safety Information:
- 4, may cause irritation to eyes, skin and breathing, should avoid contact.
-Be careful to prevent swallowing, inhalation and contact during use and storage.
-Wear protective glasses, protective gloves and appropriate protective clothing during operation.
-In case of accidental inhalation or contact, wash plenty of water immediately and seek medical help.
-Waste shall be disposed of in accordance with local environmental regulations and shall not be discharged at will.
Last Update：2024-04-10 22:29:15
