4,6-dichloro-5-fluoro-2-methylpyrimidine

4,6-dichloro-5-fluoro-2-methylpyrimidine - Names and Identifiers

Name	4,6-dichloro-5-fluoro-2-methylpyrimidine
Synonyms	2-Methyl-4,6-dichloro-5-fluoropyrimidine 4,6-DICHLORO-5-FLUORO-2-METHYLPYRIMIDINE 4,6-dichloro-5-fluoro-2-methylpyrimidine PyriMidine, 4,6-dichloro-5-fluoro-2-Methyl- pyrimidine, 4,6-dichloro-5-fluoro-2-methyl-
CAS	105806-13-1
InChI	InChI=1/C5H3Cl2FN2/c1-2-9-4(6)3(8)5(7)10-2/h1H3

4,6-dichloro-5-fluoro-2-methylpyrimidine - Physico-chemical Properties

Molecular Formula	C5H3Cl2FN2
Molar Mass	181
Density	1.504
Boling Point	221℃
Flash Point	87℃
Vapor Presure	0.167mmHg at 25°C
pKa	-4.96±0.39(Predicted)
Storage Condition	under inert gas (nitrogen or Argon) at 2-8°C
Refractive Index	1.528

4,6-dichloro-5-fluoro-2-methylpyrimidine - Risk and Safety

Hazard Class

IRRITANT

4,6-dichloro-5-fluoro-2-methylpyrimidine - Introduction

4,6-Dichloro-5-fluoro-2-methylpyrimidine (4, pyridinium) is an organic compound. Its properties are as follows:

1. Appearance and physical state: 4,6-dichloro -5-fluoro -2-methyl pyrimidine is a white crystalline solid.
2. molecular formula: C5H3Cl2FN2
3. Molecular weight: 177.99g/mol
4. Melting point: 84-88°C
5. Boiling point: 234-236°C
6. Solubility: It can be dissolved in some organic solvents, such as alcohols and esters.

4,6-dichloro-5-fluoro-2-methylpyrimidine is mainly used as reagents and intermediates in organic synthesis. It can be used to synthesize drugs, pesticides and other organic compounds. Specific applications include:

1. drug synthesis: it can be used as enzyme inhibitors, anti-cancer drugs and other drugs synthesis intermediates.
2. Pesticide synthesis: It can be used to synthesize intermediates or key structures of pesticides.
3. Other organic synthesis: It can be used to synthesize other organic compounds, such as ligands, dyes and polymers.

The preparation method of 4,6-dichloro-5-fluoro-2-methylpyrimidine can be carried out by the following steps:

1.2-methyl pyrimidine is reacted with chloroformyl chloride to generate 2-methyl -4-chloropyrimidine.
2.2-methyl -4-chloropyrimidine reacts with phosphorus oxychloride (PCl3) to generate 2-methyl -4-chloro -6-oxopyrimidine.
3. React 2-methyl -4-chloro -6-oxopyrimidine with an alkaline fluorinating agent, such as potassium fluoride or silver fluoride, to generate 4,6-dichloro -5-fluoro -2-methyl pyrimidine.

Regarding safety information, 4,6-dichloro-5-fluoro-2-methylpyrimidine is a chemical that needs to be used in accordance with the appropriate safety procedures and guidelines. General safety considerations include:

1. Avoid contact with skin, eyes or body.
2. Use appropriate personal protective equipment such as gloves, glasses and protective clothing during operation.
3. Operate in a well-ventilated environment to avoid inhalation of harmful substances.
4. Store away from fire, high temperature and oxidant.
5. Carefully read and follow the safety data sheet (SDS) and relevant operating instructions for chemicals before use or handling.

Last Update：2024-04-09 20:02:46