4-(3-chlorophenyl)morpholine

4-(3-chlorophenyl)morpholine - Names and Identifiers

Name	4-(3-chlorophenyl)morpholine
Synonyms	N-(m-Chlorophenyl)morpholine 4-(3-Chlorophenyl)morpholine 4-(3-chlorophenyl)morpholine morpholine, 4-(3-chlorophenyl)-
CAS	41605-90-7
InChI	InChI=1/C10H12ClNO/c11-9-2-1-3-10(8-9)12-4-6-13-7-5-12/h1-3,8H,4-7H2

4-(3-chlorophenyl)morpholine - Physico-chemical Properties

Molecular Formula	C10H12ClNO
Molar Mass	197.66
Density	1.2g/cm³
Boling Point	324°C at 760 mmHg
Flash Point	149.8°C
Vapor Presure	0.000252mmHg at 25°C
Storage Condition	2-8°C
Refractive Index	1.556

4-(3-chlorophenyl)morpholine - Introduction

4-(3-chroophenyl) morpholine is an organic compound with the chemical formula C10H11ClNO. It is a white crystalline solid with a peculiar smell of grass protein. The following is a description of the properties, uses, preparation and safety information of the compound:

Nature:
1. Appearance: white crystalline solid;
2. Solubility: Soluble in some organic solvents, such as ethanol, dimethylformamide, etc;
3. melting point: about 74-76 ℃.

Use:
4-(3-chroophenyl) morpholine has some applications in the field of organic synthesis:
1. As raw materials and intermediates, used in the synthesis of various drugs and chemicals;
2. can be used for synthetic dyes, pesticides and surfactants and other chemical products;
3. can also be used as a reagent for chemical analysis.

Preparation Method:
4-(3-chlorophenyl)morpholine can be synthesized by the following reaction:
1. In the presence of strong base, chlorobenzene and morpholine are substituted to produce 4-(3-chlorophenyl)morpholine.

Safety Information:
1. 4-(3-chroophenyl) morpholine is a chemical, and attention should be paid to compliance with relevant operating specifications;
2. contact or inhalation may cause irritation, should take appropriate protective measures, such as wearing gloves, protective glasses and masks;
3. avoid long-term contact and inhalation, can cause damage to the skin, eyes and respiratory system;
4. in case of accidental contact with skin, rinse immediately with plenty of water and seek medical help;
5. if accidentally into the eyes, should immediately rinse with plenty of water, and seek medical help;
6. if inhaled or accidentally eaten, should be quickly sent to hospital;
7. should be stored in a cool, dry and well-ventilated place, avoid contact with oxidants and strong acids.

Last Update：2024-04-09 15:17:57