4-Amino-2-bromonitrobenzene
3-Bromo-4-nitroaniline
CAS: 40787-96-0
Molecular Formula: C6H5BrN2O2
4-Amino-2-bromonitrobenzene - Names and Identifiers
| Name | 3-Bromo-4-nitroaniline |
| Synonyms | 3-Bromo-4-nitroaniline 3-BROMO-4-NITROANILINE 4-Nitro-3-bromoaniline 4-Amino-2-bromonitrobenzene Benzenamine, 3-bromo-4-nitro- |
| CAS | 40787-96-0 |
| InChI | InChI=1/C6H5BrN2O2/c7-5-3-4(8)1-2-6(5)9(10)11/h1-3H,8H2 |
4-Amino-2-bromonitrobenzene - Physico-chemical Properties
| Molecular Formula | C6H5BrN2O2 |
| Molar Mass | 217.02 |
| Density | 1.812±0.06 g/cm3(Predicted) |
| Melting Point | 259 °C |
| Boling Point | 339.3±22.0 °C(Predicted) |
| Flash Point | 159.016°C |
| Vapor Presure | 0mmHg at 25°C |
| pKa | -0.07±0.10(Predicted) |
| Storage Condition | 2-8°C(protect from light) |
| Refractive Index | 1.67 |
4-Amino-2-bromonitrobenzene - Risk and Safety
| Hazard Note | Toxic |
4-Amino-2-bromonitrobenzene - Introduction
3-Bromo-4-nitroaniline is an organic compound with the chemical formula C6H5BrN2O2. The following is a description of its nature, use, formulation and safety information:
Nature:
1. Appearance: 3-Bromo-4-nitroaniline is a pale yellow to yellow crystalline solid.
2. solubility: its solubility in water is low, more soluble in ethanol, chloroform and benzene and other organic solvents.
3. Melting point: Its melting point is about 127-129°C.
4. chemical reaction: 3-Bromo-4-nitroaniline can participate in amination reaction, cation substitution reaction, etc.
Use:
1. Chemical synthesis: 3-Bromo-4-nitroaniline can be used as an intermediate in organic synthesis. It can be further converted into other organic compounds, such as fluorescent dyes, drugs, dye intermediates, etc.
2. analytical chemistry: due to its special properties in chemical reactions, 3-Bromo-4-nitroaniline can also be used for dyes and indicators in analytical chemistry.
Preparation Method:
3-Bromo-4-nitroaniline is generally prepared by bromination and nitration of acetanilide. First, acetanilide is dissolved in sulfuric acid, and concentrated hydrochloric acid is slowly added dropwise to produce hydrochloride. Then, a solution of ferrous bromide was slowly added dropwise to the reaction mixture to produce 3-bromoacetanilide. Finally, nitric acid is reacted with the resulting 3-bromoacetanilide to give the target product 3-Bromo-4-nitroaniline.
Safety Information:
1. 3-Bromo-4-nitroaniline has a certain irritation to the skin and eyes. Immediately after contact, rinse with plenty of water and seek medical help.
2. It is also a potential hazard to the environment. When using or handling the compound, comply with the relevant provisions of environmental protection.
3. during storage and transportation, it should be sealed and kept away from heat and fire sources.
Please note that when handling or using chemicals, you should follow the correct laboratory safety procedures and refer to its safety data form or related resources for more detailed information.
Nature:
1. Appearance: 3-Bromo-4-nitroaniline is a pale yellow to yellow crystalline solid.
2. solubility: its solubility in water is low, more soluble in ethanol, chloroform and benzene and other organic solvents.
3. Melting point: Its melting point is about 127-129°C.
4. chemical reaction: 3-Bromo-4-nitroaniline can participate in amination reaction, cation substitution reaction, etc.
Use:
1. Chemical synthesis: 3-Bromo-4-nitroaniline can be used as an intermediate in organic synthesis. It can be further converted into other organic compounds, such as fluorescent dyes, drugs, dye intermediates, etc.
2. analytical chemistry: due to its special properties in chemical reactions, 3-Bromo-4-nitroaniline can also be used for dyes and indicators in analytical chemistry.
Preparation Method:
3-Bromo-4-nitroaniline is generally prepared by bromination and nitration of acetanilide. First, acetanilide is dissolved in sulfuric acid, and concentrated hydrochloric acid is slowly added dropwise to produce hydrochloride. Then, a solution of ferrous bromide was slowly added dropwise to the reaction mixture to produce 3-bromoacetanilide. Finally, nitric acid is reacted with the resulting 3-bromoacetanilide to give the target product 3-Bromo-4-nitroaniline.
Safety Information:
1. 3-Bromo-4-nitroaniline has a certain irritation to the skin and eyes. Immediately after contact, rinse with plenty of water and seek medical help.
2. It is also a potential hazard to the environment. When using or handling the compound, comply with the relevant provisions of environmental protection.
3. during storage and transportation, it should be sealed and kept away from heat and fire sources.
Please note that when handling or using chemicals, you should follow the correct laboratory safety procedures and refer to its safety data form or related resources for more detailed information.
Last Update：2024-04-09 21:04:16
