4-Chloro-6-methoxy-quizoline

4-Chloro-6-methoxy-quizoline - Names and Identifiers

Name	6-methoxyquinazolin-4-amine
Synonyms	6-methoxyquinazolin-4-amine 4-Chloro-6-methoxy-quizoline 4-Chloro-6-Methoxyquinazo... 4-Quinazolinamine, 6-Methoxy- 6-Methoxy-Quinazolin-4-Ylamine 6-METHOXY-QUINAZOLIN-4-YLAMINE Quinazoline, 4-chloro-6-methoxy- 4-chloro-6-Methoxy-4a,8a-dihydroquinazoline
CAS	50424-28-7 885277-51-0
InChI	InChI=1/C9H9N3O/c1-13-6-2-3-8-7(4-6)9(10)12-5-11-8/h2-5H,1H3,(H2,10,11,12)

4-Chloro-6-methoxy-quizoline - Physico-chemical Properties

Molecular Formula	C9H7ClN2O
Molar Mass	194.62
Density	1.333±0.06 g/cm3(Predicted)
Melting Point	107.5-108 °C
Boling Point	323.0±22.0 °C(Predicted)
Flash Point	174.941°C
Vapor Presure	0mmHg at 25°C
pKa	0.59±0.30(Predicted)
Storage Condition	under inert gas (nitrogen or Argon) at 2-8°C
Refractive Index	1.675

4-Chloro-6-methoxy-quizoline - Introduction

6-methoxyquinazolin-4-amine is an organic compound whose chemical formula is C10H10N4O.

Nature:
1. Appearance: 6-methoxyquinazolin-4-amine is a white to light yellow crystalline powder.
2. Solubility: It has good solubility in common organic solvents.
3. Melting point: Its melting point range is usually between 180-182°C.

Use:
6-methoxyquinazolin-4-amine has a wide range of applications in the field of medicinal chemistry, including the following aspects:
1. As a drug precursor: It can be used as an intermediate for the synthesis of other drugs, and its biological activity and physicochemical properties can be changed by chemical modification of its structure.
2. Anti-cancer research: It is used to research and develop new anti-cancer drugs because it has the potential to inhibit the growth and spread of tumor cells.
3. Endogenous functional group detection: It can be used as a fluorescent probe for detecting and determining specific biologically active molecules in biological samples.

Preparation Method:
The preparation method of 6-methoxyquinazolin-4-amine can be carried out by the following steps:
1. First, 2,3-diaminopyridine is reacted with 4-chloromethoxyacetophenone to obtain the intermediate 4-chloromethoxypyridine-2, 3-diamine.
2. Then, by reacting with sodium hypochlorite, the methyl ether group in the intermediate is converted into methylamino group to generate 6-methoxyquinazolin-4-amine.

Safety Information:
1. 6-methoxyquinazolin-4-amine is a chemical that must be used under appropriate laboratory conditions to avoid contact with skin, eyes and inhalation.
2. Follow proper laboratory safety procedures, including wearing appropriate protective equipment, such as gloves and goggles.
3. The supplier shall provide the relevant safety data sheet, which contains detailed safety information and operating recommendations for the compound.

Last Update：2024-04-09 21:01:54