4-Ethoxybenzaldehyde
4-Ethoxybenzaldehyde
CAS: 10031-82-0
Molecular Formula: C9H10O2
4-Ethoxybenzaldehyde - Names and Identifiers
| Name | 4-Ethoxybenzaldehyde |
| Synonyms | Homoanisaldehyde Ethoxybenzaldehyde 4-ethoxy-benzaldehyd 4-Ethoxybenzaldehyde P-Ethyoxybenzaldehyde Benzaldehyde,4-ethoxy- Benzaldehyde, p-ethoxy- 4-Ethoxybenzenecarbaldehyde |
| CAS | 10031-82-0 |
| EINECS | 233-093-3 |
| InChI | InChI=1/C9H10O2/c1-2-11-9-6-4-3-5-8(9)7-10/h3-7H,2H2,1H3 |
4-Ethoxybenzaldehyde - Physico-chemical Properties
| Molecular Formula | C9H10O2 |
| Molar Mass | 150.17 |
| Density | 1.08g/mLat 25°C(lit.) |
| Melting Point | 13-14°C(lit.) |
| Boling Point | 255°C(lit.) |
| Flash Point | >230°F |
| JECFA Number | 879 |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 0.0249mmHg at 25°C |
| Appearance | Liquid |
| Specific Gravity | 1.08 |
| Color | Clear yellow to light brown |
| BRN | 386863 |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Sensitive | Air Sensitive |
| Refractive Index | n20/D 1.559(lit.) |
| Physical and Chemical Properties |
|
| Use | Used as a pharmaceutical Intermediate |
4-Ethoxybenzaldehyde - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection S24/25 - Avoid contact with skin and eyes. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | CU6100000 |
| TSCA | Yes |
| HS Code | 29124990 |
| Hazard Note | Irritant |
| Toxicity | GRAS(FEMA)。 |
4-Ethoxybenzaldehyde - Reference Information
| toxicity | GRAS(FEMA). |
| usage limit | FEMA(mg/kg): beverage 0.06~0.08; Cold drinks 0.36~0.50; Candy, baked goods, 1.0. The right amount is limited (FDA,§ 172.515,2001). |
| use | used as a pharmaceutical intermediate |
| NIST chemical information | The information is provided by: webbook.nist.gov (external link) |
| EPA chemical information | information provided by: ofmpub.epa.gov (external link) |
Last Update：2024-04-09 21:11:58
