4-Methoxy-3-hydroxypyridine
3-Pyridinol, 4-methoxy-
CAS: 153199-54-3
Molecular Formula: C6H7NO2
4-Methoxy-3-hydroxypyridine - Names and Identifiers
| Name | 3-Pyridinol, 4-methoxy- |
| Synonyms | 4-methoxypyridin-3-ol 4-methoxy-3-Pyridinol 3-Pyridinol, 4-methoxy- 3-Hydroxy-4-methoxypyridine 3-Pyridinol,4-methoxy-(9CI) 4-Methoxy-3-hydroxypyridine |
| CAS | 153199-54-3 |
| EINECS | 604-604-1 |
| InChI | InChI=1/C6H7NO2/c1-9-6-2-3-7-4-5(6)8/h2-4,8H,1H3 |
4-Methoxy-3-hydroxypyridine - Physico-chemical Properties
| Molecular Formula | C6H7NO2 |
| Molar Mass | 125.13 |
| Density | 1.190±0.06 g/cm3(Predicted) |
| Boling Point | 326.1±22.0 °C(Predicted) |
| Flash Point | 151.023°C |
| Vapor Presure | 0mmHg at 25°C |
| pKa | 9.44±0.18(Predicted) |
| Storage Condition | 2-8°C(protect from light) |
| Refractive Index | 1.539 |
4-Methoxy-3-hydroxypyridine - Risk and Safety
| Hazard Class | IRRITANT |
4-Methoxy-3-hydroxypyridine - Introduction
3-Pyridinol, 4-methoxy-is an organic compound with the chemical formula C6H7NO2. It is a solid with a white or white-like color.
Some of the properties of this compound are as follows:
1. Melting point: about 130-133 degrees Celsius.
2. Boiling point: About 328-330 degrees Celsius.
3. Solubility: low solubility in water, but can be dissolved in many organic solvents such as methanol, ethanol and dimethylformamide.
3-Pyridinol, 4-methoxy-has many uses in the pharmaceutical field, such:
1. It can be used as an important intermediate and play a key role in the synthesis of drugs.
2. As a synthetic precursor of antibiotics, it can inhibit the growth of bacteria.
The method of preparing 3-Pyridinol, 4-methoxy-generally includes the following steps:
1. Add pyridine to the ethanol solution.
2. N-formyl urea is added to the reaction system, and the reaction generates an intermediate.
3. Finally, sodium hydroxide was added to obtain the target product.
Some safety precautions need to be paid attention to when using and handling 3-Pyridinol, 4-methoxy:
1. The compound will decompose to produce harmful gases when heated, so you need to pay attention to ventilation conditions.
2. Avoid contact with skin and eyes, and wear personal protective equipment such as gloves and goggles when using.
3. Storage should avoid contact with the oxidant, away from the fire and high temperature environment.
Some of the properties of this compound are as follows:
1. Melting point: about 130-133 degrees Celsius.
2. Boiling point: About 328-330 degrees Celsius.
3. Solubility: low solubility in water, but can be dissolved in many organic solvents such as methanol, ethanol and dimethylformamide.
3-Pyridinol, 4-methoxy-has many uses in the pharmaceutical field, such:
1. It can be used as an important intermediate and play a key role in the synthesis of drugs.
2. As a synthetic precursor of antibiotics, it can inhibit the growth of bacteria.
The method of preparing 3-Pyridinol, 4-methoxy-generally includes the following steps:
1. Add pyridine to the ethanol solution.
2. N-formyl urea is added to the reaction system, and the reaction generates an intermediate.
3. Finally, sodium hydroxide was added to obtain the target product.
Some safety precautions need to be paid attention to when using and handling 3-Pyridinol, 4-methoxy:
1. The compound will decompose to produce harmful gases when heated, so you need to pay attention to ventilation conditions.
2. Avoid contact with skin and eyes, and wear personal protective equipment such as gloves and goggles when using.
3. Storage should avoid contact with the oxidant, away from the fire and high temperature environment.
Last Update：2024-04-09 21:00:56
Supplier List
Product Name: 3-Pyridinol,4-methoxy-(9CI) Visit Supplier Webpage Request for quotation
CAS: 153199-54-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 153199-54-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 3-Pyridinol,4-methoxy-(9CI) Visit Supplier Webpage Request for quotation
CAS: 153199-54-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 153199-54-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History