4-azatricyclo(4.3.1.1(3,8))undecan-5-one
4-azatricyclo(4.3.1.1(3,8))undecan-5-one
CAS: 22607-75-6
Molecular Formula: C10H15NO
4-azatricyclo(4.3.1.1(3,8))undecan-5-one - Names and Identifiers
| Name | 4-azatricyclo(4.3.1.1(3,8))undecan-5-one |
| Synonyms | NSC 145164 AKOS BC-0498 4-AZAHOMOADAMANTAN-5-ONE 4-Azatricyclo[4.3.1.13,8]undecan-5-one 5-Azatricyclo[4.3.1.13,8]undecane-4-one 4-azatricyclo(4.3.1.1(3,8))undecan-5-one 4-Azatricyclo[4.3.1.1(3,8)]Undecan-5-One 4-azatricyclo[4.3.1.1~3,8~]undecan-5-one 4-AZATRICYCLO[4.3.1.1(3,8)]UNDECAN-5-ONE 4-Azaazatricyclo[4.3.1.13,8]undecan-5-one 4-azatricyclo(4.3.1.1(sup3,8))undecan-5-one (1S)-4-azatricyclo[4.3.1.1~3,8~]undecan-5-one |
| CAS | 22607-75-6 |
| InChI | InChI=1/C10H15NO/c12-10-8-2-6-1-7(3-8)5-9(4-6)11-10/h6-9H,1-5H2,(H,11,12) |
4-azatricyclo(4.3.1.1(3,8))undecan-5-one - Physico-chemical Properties
| Molecular Formula | C10H15NO |
| Molar Mass | 165.23 |
| Density | 1.103±0.06 g/cm3 (20 ºC 760 Torr) |
| Melting Point | 316-318°C(lit.) |
| Boling Point | 344.0±11.0 °C(Predicted) |
| Flash Point | 201.3°C |
| Solubility | chloroform: soluble2.5%, clear, colorless |
| Vapor Presure | 6.78E-05mmHg at 25°C |
| pKa | 15.95±0.20(Predicted) |
| Storage Condition | Room Temprature |
| Refractive Index | 1.522 |
4-azatricyclo(4.3.1.1(3,8))undecan-5-one - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | CM0732000 |
| Hazard Class | IRRITANT |
4-azatricyclo(4.3.1.1(3,8))undecan-5-one - Introduction
4-azatricyclo(4.3.1.1(3,8))undecan-5-one, also known as 4-azatricyclo(4.3.1.1(3,8))undecan-5-one, is an organic compound. The following is a description of its nature, use, formulation and safety information:
Nature:
-Appearance: Colorless to light yellow solid
-Solubility: Soluble in some organic solvents, such as alcohols and ketones
-Melting point: About 100-110 ° C
-Molecular formula: C10H17NO
-Molecular weight: 167.25g/mol
Use:
- 4-azatricyclo(4.3.1.1(3,8))undecan-5-one is commonly used as a synthetic intermediate in organic synthesis. It can be used to synthesize biologically active compounds, such as drugs, pesticides, etc.
-Because of its unique structure, it can be used to research and develop new materials, such as polymer materials, liquid crystals, etc.
Method:
- 4-azatricyclo(4.3.1.1(3,8))undecan-5-one is generally prepared by chemical synthesis.
-The specific preparation method may include that the corresponding substrate undergoes a series of reactions, including acylation, reduction, amination, etc.
Safety Information:
- 4-azatricyclo(4.3.1.1(3,8))undecan-5-one is generally relatively safe under normal operating conditions, but the following points still need to be noted:
-Avoid inhalation, ingestion or skin contact with this compound as it may cause irritation to the body.
-When using and operating, please use appropriate personal protective equipment, such as gloves, glasses, etc.
-It should be operated in a well-ventilated place and avoid contact with combustibles.
Nature:
-Appearance: Colorless to light yellow solid
-Solubility: Soluble in some organic solvents, such as alcohols and ketones
-Melting point: About 100-110 ° C
-Molecular formula: C10H17NO
-Molecular weight: 167.25g/mol
Use:
- 4-azatricyclo(4.3.1.1(3,8))undecan-5-one is commonly used as a synthetic intermediate in organic synthesis. It can be used to synthesize biologically active compounds, such as drugs, pesticides, etc.
-Because of its unique structure, it can be used to research and develop new materials, such as polymer materials, liquid crystals, etc.
Method:
- 4-azatricyclo(4.3.1.1(3,8))undecan-5-one is generally prepared by chemical synthesis.
-The specific preparation method may include that the corresponding substrate undergoes a series of reactions, including acylation, reduction, amination, etc.
Safety Information:
- 4-azatricyclo(4.3.1.1(3,8))undecan-5-one is generally relatively safe under normal operating conditions, but the following points still need to be noted:
-Avoid inhalation, ingestion or skin contact with this compound as it may cause irritation to the body.
-When using and operating, please use appropriate personal protective equipment, such as gloves, glasses, etc.
-It should be operated in a well-ventilated place and avoid contact with combustibles.
Last Update：2024-04-09 21:04:16
Supplier List
Product Name: 4-Azahomoadamantan-5-one Visit Supplier Webpage Request for quotation
CAS: 22607-75-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 22607-75-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 4-Azahomoadamantan-5-one Visit Supplier Webpage Request for quotation
CAS: 22607-75-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 22607-75-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History