4-chloro-2-fluoro-1-methoxybenzene
4-chloro-2-fluoroanisole
CAS: 452-09-5
Molecular Formula: C7H6ClFO
4-chloro-2-fluoro-1-methoxybenzene - Names and Identifiers
| Name | 4-chloro-2-fluoroanisole |
| Synonyms | 4-chloro-2-fluoroanisole 2-Fluoro-4-chloroanisole 4-CHLORO-2-FLUOROANISOLE 2,4-difluoro-1-methoxybenzene 4-Chloro-2-fluoro-1-methoxybenzene 4-chloro-2-fluoro-1-methoxybenzene Benzene, 4-chloro-2-fluoro-1-methoxy- |
| CAS | 452-09-5 |
| InChI | InChI=1/C7H6ClFO/c1-10-7-3-2-5(8)4-6(7)9/h2-4H,1H3 |
4-chloro-2-fluoro-1-methoxybenzene - Physico-chemical Properties
| Molecular Formula | C7H6ClFO |
| Molar Mass | 160.57 |
| Density | 1.294g/mLat 25°C(lit.) |
| Boling Point | 160°C(lit.) |
| Flash Point | 175°F |
| Vapor Presure | 0.8mmHg at 25°C |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.518(lit.) |
4-chloro-2-fluoro-1-methoxybenzene - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | 1993 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
4-chloro-2-fluoro-1-methoxybenzene - Introduction
4-choro-2-fluoroanisole is an organic compound with the chemical formula C7H5ClFO. The following is an introduction to some of its properties, uses, methods and safety information:
Nature:
1. Appearance: 4-chloro-2-fluoroanisole is a colorless liquid.
2. melting point:-15 ℃
3. Boiling point: 134-136 ℃
4. density: 1.26g/cm³
5. Stability: It is relatively stable at room temperature, but combustion reaction may occur when encountering high temperature, fire source or oxidant.
Use:
1. as an organic synthesis intermediate, used in the synthesis of other organic compounds.
2. used as raw materials for pharmaceutical, pesticide and pigment industries.
Preparation Method:
4-chloro-2-fluoroanisole can be prepared by the fluorination reaction between anisole and chloroflurane. The specific synthetic steps can be carried out in a chemical laboratory.
Safety Information:
1. highly volatile, avoid inhalation of vapor or contact with liquid.
2. flammable, avoid contact with fire and high temperature.
3. the eye and skin irritation, use should take appropriate protective measures.
4. In storage and handling, should follow the general safety specifications of chemicals, keep away from fire and high temperature environment.
Nature:
1. Appearance: 4-chloro-2-fluoroanisole is a colorless liquid.
2. melting point:-15 ℃
3. Boiling point: 134-136 ℃
4. density: 1.26g/cm³
5. Stability: It is relatively stable at room temperature, but combustion reaction may occur when encountering high temperature, fire source or oxidant.
Use:
1. as an organic synthesis intermediate, used in the synthesis of other organic compounds.
2. used as raw materials for pharmaceutical, pesticide and pigment industries.
Preparation Method:
4-chloro-2-fluoroanisole can be prepared by the fluorination reaction between anisole and chloroflurane. The specific synthetic steps can be carried out in a chemical laboratory.
Safety Information:
1. highly volatile, avoid inhalation of vapor or contact with liquid.
2. flammable, avoid contact with fire and high temperature.
3. the eye and skin irritation, use should take appropriate protective measures.
4. In storage and handling, should follow the general safety specifications of chemicals, keep away from fire and high temperature environment.
Last Update：2024-04-09 02:00:46
Supplier List
Product Name: 4-Chloro-2-Fluoroanisole Visit Supplier Webpage Request for quotation
CAS: 452-09-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 452-09-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 4-Chloro-2-Fluoroanisole Visit Supplier Webpage Request for quotation
CAS: 452-09-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 452-09-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History