4-methyl-3-oxo-N-phenyl-2-(phenylmethylene)pentanamide
2-Benzylidene isobutyryl acetanilide
CAS: 125971-57-5
Molecular Formula: C19H19NO2
4-methyl-3-oxo-N-phenyl-2-(phenylmethylene)pentanamide - Names and Identifiers
| Name | 2-Benzylidene isobutyryl acetanilide |
| Synonyms | Atorvastatin Impurity 70 2-Benylidine isobutyryl acetanilide 2-Benzylidene isobutyryl acetanilide 2-Isobutyryl-N-phenyl-3-phenylacrylamide 2-BENZYLIDENE-N-PHENYL-ISOBUTYLOYLACETAMIDE 2-Benzylidene-N-phenyl-isobutyloyl acetamide 4-METHYL-3-OXO-N-PHENYL-2-(PHENYLMETHYLENE)-PENTAN (Z)-2-benzylidene-4-methyl-3-oxo-N-phenylpentanamide (2E)-2-benzylidene-4-methyl-3-oxo-N-phenylpentanamide 4-METHYL-3-OXO-N-PHENYL-2-(PHENYLMETHYLENE)PENTANAMIDE 4-methyl-3-oxo-N-phenyl-2-(phenylmethylene)pentanamide Pentanamide, 4-methyl-3-oxo-N-phenyl-2-(phenylmethylene)- |
| CAS | 125971-57-5 |
| EINECS | 1312995-182-4 |
| InChI | InChI=1/C19H19NO2/c1-14(2)18(21)17(13-15-9-5-3-6-10-15)19(22)20-16-11-7-4-8-12-16/h3-14H,1-2H3,(H,20,22)/b17-13+ |
4-methyl-3-oxo-N-phenyl-2-(phenylmethylene)pentanamide - Physico-chemical Properties
| Molecular Formula | C19H19NO2 |
| Molar Mass | 293.36 |
| Density | 1.151±0.06 g/cm3(Predicted) |
| Melting Point | 143-154°C |
| Boling Point | 519.4±50.0 °C(Predicted) |
| Flash Point | 188.668°C |
| Vapor Presure | 0-0Pa at 25-72℃ |
| Appearance | Powder |
| pKa | 12.23±0.70(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.622 |
| Physical and Chemical Properties | Melting point 143-154°C |
4-methyl-3-oxo-N-phenyl-2-(phenylmethylene)pentanamide - Reference Information
| LogP | 2.2 at 38℃ |
| surface tension | 67.9mN/m at 9.4mg/L and 20 ℃ |
Last Update：2024-04-09 02:00:04
