4-propylpyridin-2-aMine
4-PROPYL-PYRIDIN-2-YLAMINE
CAS: 61702-15-6
Molecular Formula: C8H12N2
4-propylpyridin-2-aMine - Names and Identifiers
| Name | 4-PROPYL-PYRIDIN-2-YLAMINE |
| Synonyms | 4-propyl-2-pyridinamine 4-propylpyridin-2-aMine 4-propylpyridin-2-amine 2-Amino-4-propylpyridine 2-AMINO-4-PROPYL PYRIDINE 2-Pyridinamine, 4-propyl- 4-PROPYL-PYRIDIN-2-YLAMINE |
| CAS | 61702-15-6 |
| InChI | InChI=1/C8H12N2/c1-2-3-7-4-5-10-8(9)6-7/h4-6H,2-3H2,1H3,(H2,9,10) |
4-propylpyridin-2-aMine - Physico-chemical Properties
| Molecular Formula | C8H12N2 |
| Molar Mass | 136.19 |
| Density | 1.014g/cm3 |
| Boling Point | 257.4°C at 760 mmHg |
| Flash Point | 133.2°C |
| Vapor Presure | 0.0146mmHg at 25°C |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Refractive Index | 1.549 |
4-propylpyridin-2-aMine - Introduction
It is an organic compound with the following properties:
1. appearance: colorless liquid or solid.
2. molecular formula: C9H14N2
3. Molecular weight: 150.22g/mol
4. Melting point: 61-65°C
5. Boiling point: 239-241°C
6. Solubility: Soluble in organic solvents, such as alcohol, ether, etc.
It is often used in the synthesis of drugs, pesticides and dyes. As an organic intermediate, it plays an important role in organic synthesis.
The preparation method can be carried out by the following steps:
1.2-Bromopyridine reacts with propylamine to generate 2-propyl pyridine.
2. React 2-propylpyridine with ammonia gas, and convert the propyl group into amino group in the presence of a catalyst to obtain pyridine.
Regarding safety information, it is an organic compound and should have a certain sense of safe operation. Here are some safety considerations:
1. avoid direct contact with skin and eyes, such as inadvertent contact, should promptly rinse with plenty of water.
2. in the process of operation to avoid inhalation of its vapor or dust, to ensure good ventilation conditions.
3. Wear personal protective equipment such as protective gloves and glasses during operation.
4. storage should be sealed in a cool, dry place, away from combustibles and oxidants.
5. Waste disposal should be carried out in accordance with relevant laws and regulations to avoid direct discharge into the environment.
1. appearance: colorless liquid or solid.
2. molecular formula: C9H14N2
3. Molecular weight: 150.22g/mol
4. Melting point: 61-65°C
5. Boiling point: 239-241°C
6. Solubility: Soluble in organic solvents, such as alcohol, ether, etc.
It is often used in the synthesis of drugs, pesticides and dyes. As an organic intermediate, it plays an important role in organic synthesis.
The preparation method can be carried out by the following steps:
1.2-Bromopyridine reacts with propylamine to generate 2-propyl pyridine.
2. React 2-propylpyridine with ammonia gas, and convert the propyl group into amino group in the presence of a catalyst to obtain pyridine.
Regarding safety information, it is an organic compound and should have a certain sense of safe operation. Here are some safety considerations:
1. avoid direct contact with skin and eyes, such as inadvertent contact, should promptly rinse with plenty of water.
2. in the process of operation to avoid inhalation of its vapor or dust, to ensure good ventilation conditions.
3. Wear personal protective equipment such as protective gloves and glasses during operation.
4. storage should be sealed in a cool, dry place, away from combustibles and oxidants.
5. Waste disposal should be carried out in accordance with relevant laws and regulations to avoid direct discharge into the environment.
Last Update：2024-04-09 20:02:46
Supplier List
Product Name: 4-PROPYL-PYRIDIN-2-YLAMINE Visit Supplier Webpage Request for quotation
CAS: 61702-15-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 61702-15-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 4-PROPYL-PYRIDIN-2-YLAMINE Visit Supplier Webpage Request for quotation
CAS: 61702-15-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 61702-15-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History