4599-47-7

4599-47-7 - Names and Identifiers

Name	4-methylphenylalanine
Synonyms	4-methylphenylalanine phenylalanine, 4-methyl- 4-Methyl-DL-phenylalanine
CAS	4313-79-5 4599-47-7 7758-37-4
InChI	InChI=1/C10H13NO2/c1-7-2-4-8(5-3-7)6-9(11)10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13)

4599-47-7 - Physico-chemical Properties

Molecular Formula	C10H13NO2
Density	1.165g/cm³
Melting Point	277℃
Boling Point	323.5°C at 760 mmHg
Flash Point	149.5°C
Vapor Presure	0.000107mmHg at 25°C
Storage Condition	Room Temprature
Refractive Index	1.568

4599-47-7 - Introduction

4-methylphenylalanine is an organic compound with the chemical formula C10H13NO2. It is a derivative of phenylalanine. In the molecular structure, there is a methyl group on the benzene ring. 4-methylphenylalanine usually exists in the form of white crystals and has a specific amino acid structure.

Nature:
4-methylphenylalanine has a crystalline form with a melting point of about 185-188 degrees Celsius. It is less soluble in water and soluble in most organic solvents.

Use:
4-methylphenylalanine can be used in the preparation of synthetic drugs, intermediates and biologically active substances. It has certain application potential in the field of medicine, for example, it can be used as a raw material for the synthesis of hormones, peptides and glucocorticoids. In addition, it can also be used to synthesize functional compounds and materials.

Preparation Method:
4-methylphenylalanine can be obtained by chemical synthesis or biological synthesis. The chemical synthesis method generally involves a substitution reaction on toluene, introducing a methyl group onto the benzene ring, followed by a condensation reaction with alanine. The biosynthetic method is prepared by biocatalysis using a method such as microbial fermentation or enzymatic catalysis.

Safety Information:
4-methylphenylalanine is generally relatively safe under normal use, but the following issues still need to be paid attention:
-Need to store properly, away from high temperature, fire and oxidant.
-Wear appropriate personal protective equipment such as gloves, goggles and protective clothing when used.
-Avoid inhaling dust and contact with skin or eyes. In case of accidental contact, rinse immediately with plenty of water and seek medical help.
-Follow relevant safety handling and management measures when using or handling the compound.

Last Update：2024-04-09 20:52:54