4745-93-1
4,7-Diazaindole
CAS: 4745-93-1
Molecular Formula: C6H5N3
4745-93-1 - Names and Identifiers
| Name | 4,7-Diazaindole |
| Synonyms | 4,7-Diazaindole 5H-Pyrrolo[2,3-b]pyrazine 4,7-DIAZAINDOLE,5H-PYRROLO[2,3-B]PYRAZINE |
| CAS | 4745-93-1 |
| InChI | InChI=1/C6H5N3/c1-2-8-6-5(1)7-3-4-9-6/h1-4H,(H,8,9) |
4745-93-1 - Physico-chemical Properties
| Molecular Formula | C6H5N3 |
| Molar Mass | 119.12 |
| Density | 1.38 |
| Melting Point | 155-156 °C |
| Boling Point | 236 °C |
| Flash Point | 96 °C |
| pKa | 11.95±0.20(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.715 |
4745-93-1 - Introduction
4,7-Diazaindole(4,7-Diazaindole) is an organic compound with the chemical formula C8H6N4, which has a cyclic structure. The following is its nature and use, preparation and safety information:
Nature:
1. Appearance: 4,7-Diazaindole is a white to pale yellow crystalline or powdery solid.
2. Melting point: Its melting point range is 127-133°C.
3. Solubility: 4,7-Diazaindole is soluble in some organic solvents (such as ethanol and acetonitrile).
Use:
1. Intermediate in chemical synthesis: 4,7-Diazaindole can be used as an intermediate for the synthesis of other organic compounds and is used for the preparation of drugs or functional materials.
2. As a fluorescent probe: Its structural characteristics make it fluorescent and can be used for cell imaging and other applications in the biomedical field.
Preparation Method:
The preparation method of 4,7-Diazaindole is mainly realized by chemical synthesis, and the commonly used methods include:
1. Through the deaminating reaction: the reaction of indole compound and aldehyde or ketone compound is used to carry out the deaminating reaction under appropriate conditions to synthesize 4,7-Diazaindole.
2. through the ring reaction: by using appropriate reagents and conditions, the appropriate precursor molecules through the ring reaction to generate 4,7-Diazaindole.
Safety Information:
1. 4,7-Diazaindole is irritating and may irritate the eyes and skin. Attention should be paid to avoid contact.
2. When using 4,7-Diazaindole, you should pay attention to good ventilation conditions and wear appropriate protective equipment.
3. When storing 4,7-Diazaindole, it should be kept in a dry and cool place to avoid contact with oxygen, organic solvents and other substances.
It should be noted that when using 4,7-Diazaindole or preparing it, you should follow the relevant safety operation procedures and comply with local safety regulations. Timely disposal of chemical waste and proper disposal.
Nature:
1. Appearance: 4,7-Diazaindole is a white to pale yellow crystalline or powdery solid.
2. Melting point: Its melting point range is 127-133°C.
3. Solubility: 4,7-Diazaindole is soluble in some organic solvents (such as ethanol and acetonitrile).
Use:
1. Intermediate in chemical synthesis: 4,7-Diazaindole can be used as an intermediate for the synthesis of other organic compounds and is used for the preparation of drugs or functional materials.
2. As a fluorescent probe: Its structural characteristics make it fluorescent and can be used for cell imaging and other applications in the biomedical field.
Preparation Method:
The preparation method of 4,7-Diazaindole is mainly realized by chemical synthesis, and the commonly used methods include:
1. Through the deaminating reaction: the reaction of indole compound and aldehyde or ketone compound is used to carry out the deaminating reaction under appropriate conditions to synthesize 4,7-Diazaindole.
2. through the ring reaction: by using appropriate reagents and conditions, the appropriate precursor molecules through the ring reaction to generate 4,7-Diazaindole.
Safety Information:
1. 4,7-Diazaindole is irritating and may irritate the eyes and skin. Attention should be paid to avoid contact.
2. When using 4,7-Diazaindole, you should pay attention to good ventilation conditions and wear appropriate protective equipment.
3. When storing 4,7-Diazaindole, it should be kept in a dry and cool place to avoid contact with oxygen, organic solvents and other substances.
It should be noted that when using 4,7-Diazaindole or preparing it, you should follow the relevant safety operation procedures and comply with local safety regulations. Timely disposal of chemical waste and proper disposal.
Last Update：2024-04-09 19:05:49
Supplier List
Product Name: 4,7-Diazaindole Visit Supplier Webpage Request for quotation
CAS: 4745-93-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 4745-93-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 4,7-Diazaindole Visit Supplier Webpage Request for quotation
CAS: 4745-93-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 4745-93-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History